Compuestos de carbonilo
Resultados de la búsqueda filtrada
terc-Butil acetoacetato, 97 %, Thermo Scientific Chemicals
CAS: 1694-31-1 Fórmula molecular: C8H14O3 Peso molecular (g/mol): 158.2 Número MDL: MFCD00008811 Clave InChI: JKUYRAMKJLMYLO-UHFFFAOYSA-N Sinónimo: tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate PubChem CID: 15538 Nombre IUPAC: terc-butilo 3-oxobutanoato SMILES: CC(=O)CC(=O)OC(C)(C)C
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate |
|---|---|
| Clave InChI | JKUYRAMKJLMYLO-UHFFFAOYSA-N |
| PubChem CID | 15538 |
| Fórmula molecular | C8H14O3 |
| CAS | 1694-31-1 |
| Peso molecular (g/mol) | 158.2 |
| Número MDL | MFCD00008811 |
| SMILES | CC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | terc-butilo 3-oxobutanoato |
Malonato di-terc-butilo, +98 %, estable con carbonato de potasio, Thermo Scientific Chemicals
CAS: 541-16-2 Fórmula molecular: C11H20O4 Peso molecular (g/mol): 216.277 Número MDL: MFCD00008810 Clave InChI: CLPHAYNBNTVRDI-UHFFFAOYSA-N Sinónimo: di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate PubChem CID: 68324 Nombre IUPAC: propanodioato de diterc-butilo SMILES: CC(C)(C)OC(=O)CC(=O)OC(C)(C)C
| Sinónimo | di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate |
|---|---|
| Clave InChI | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| PubChem CID | 68324 |
| Fórmula molecular | C11H20O4 |
| CAS | 541-16-2 |
| Peso molecular (g/mol) | 216.277 |
| Número MDL | MFCD00008810 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | propanodioato de diterc-butilo |
Di-terc-butilo malonato, 98 %, Thermo Scientific Chemicals
CAS: 541-16-2 Número MDL: MFCD00008810 Clave InChI: CLPHAYNBNTVRDI-UHFFFAOYSA-N Sinónimo: di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate PubChem CID: 68324 Nombre IUPAC: propanodioato de diterc-butilo SMILES: CC(C)(C)OC(=O)CC(=O)OC(C)(C)C
| Sinónimo | di-tert-butyl malonate,malonic acid di-tert-butyl ester,propanedioic acid, bis 1,1-dimethylethyl ester,di-t-butylmalonate,di-t-butyl malonate,unii-7e9xwt9380,1,3-di-tert-butyl propanedioate,di tert-butyl malonate,tert-butyl 2-tert-butoxycarbonyl acetate,di-tert-butyl malonate, stab. with potassium carbonate |
|---|---|
| Clave InChI | CLPHAYNBNTVRDI-UHFFFAOYSA-N |
| PubChem CID | 68324 |
| CAS | 541-16-2 |
| Número MDL | MFCD00008810 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | propanodioato de diterc-butilo |
Malonato de hidrógeno de terc-butilo, 96 %, Thermo Scientific Chemicals
CAS: 40052-13-9 Fórmula molecular: C7H12O4 Peso molecular (g/mol): 160.169 Número MDL: MFCD00191886 Clave InChI: NGGGZUAEOKRHMA-UHFFFAOYSA-N Sinónimo: 3-tert-butoxy-3-oxopropanoic acid,malonic acid mono-tert-butyl ester,mono-tert-butyl malonate,2-tert-butoxycarbonyl acetic acid,tert-butyl hydrogen malonate,mono-t-butyl malonate,pubchem13754,malonicacidmono-tert-butylester,malonic acid mono t-butyl ester PubChem CID: 545853 Nombre IUPAC: ácido 3-[(2-metilpropan-2-il)oxi]-3-oxopropanoico SMILES: CC(C)(C)OC(=O)CC(=O)O
| Sinónimo | 3-tert-butoxy-3-oxopropanoic acid,malonic acid mono-tert-butyl ester,mono-tert-butyl malonate,2-tert-butoxycarbonyl acetic acid,tert-butyl hydrogen malonate,mono-t-butyl malonate,pubchem13754,malonicacidmono-tert-butylester,malonic acid mono t-butyl ester |
|---|---|
| Clave InChI | NGGGZUAEOKRHMA-UHFFFAOYSA-N |
| PubChem CID | 545853 |
| Fórmula molecular | C7H12O4 |
| CAS | 40052-13-9 |
| Peso molecular (g/mol) | 160.169 |
| Número MDL | MFCD00191886 |
| SMILES | CC(C)(C)OC(=O)CC(=O)O |
| Nombre IUPAC | ácido 3-[(2-metilpropan-2-il)oxi]-3-oxopropanoico |
Bencil terc-butil malonato, 95 %, Thermo Scientific Chemicals
CAS: 72594-86-6 Fórmula molecular: C14H18O4 Peso molecular (g/mol): 250.294 Número MDL: MFCD01075175 Clave InChI: XKXXXODAXXAFNP-UHFFFAOYSA-N Sinónimo: benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n PubChem CID: 2736712 Nombre IUPAC: 1-O-bencil 3-O-terc-butil propanodioato SMILES: CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1
| Sinónimo | benzyl tert-butyl malonate,benzyltert-butylmalonate,tert-butyl benzyl malonate,1-benzyl 3-tert-butyl propanedioate,tert-butyl 2-benzyloxycarbonyl acetate,propanedioic acid, 1,1-dimethylethyl phenylmethyl ester,tert-butyl phenylmethyl propane-1,3-dioate,pubchem3938,t-butyl benzyl malonate,ksc493q0n |
|---|---|
| Clave InChI | XKXXXODAXXAFNP-UHFFFAOYSA-N |
| PubChem CID | 2736712 |
| Fórmula molecular | C14H18O4 |
| CAS | 72594-86-6 |
| Peso molecular (g/mol) | 250.294 |
| Número MDL | MFCD01075175 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OCC1=CC=CC=C1 |
| Nombre IUPAC | 1-O-bencil 3-O-terc-butil propanodioato |
2-(Boc-amino)piridina-5-carboxaldehído, 97 %, Thermo Scientific Chemicals
CAS: 199296-40-7 Fórmula molecular: C11H14N2O3 Peso molecular (g/mol): 222.244 Número MDL: MFCD08064228 Clave InChI: WZROBBWIJBBWQP-UHFFFAOYSA-N Sinónimo: tert-butyl 5-formylpyridin-2-yl carbamate,tert-butyl 5-formylpyridin-2-ylcarbamate,tert-butyl n-5-formylpyridin-2-yl carbamate,2-boc-amino pyridine-5-carboxaldehyde,5-formyl-pyridin-2-yl-carbamic acid tert-butyl ester,5-formylpyridin-2-yl carbamic acid tert butyl ester,2-boc-aminopyridine-5-aldehyde,2-tert-butoxycarbonylamino pyridine-5-carboxaldehyde,carbamicacid, n-5-formyl-2-pyridinyl-, 1,1-dimethylethyl ester,6-aminonicotinaldehyde, 6-boc protected PubChem CID: 22034247 Nombre IUPAC: N-(5-formilpiridin-2-il)carbamato de terc-butil SMILES: CC(C)(C)OC(=O)NC1=NC=C(C=C1)C=O
| Sinónimo | tert-butyl 5-formylpyridin-2-yl carbamate,tert-butyl 5-formylpyridin-2-ylcarbamate,tert-butyl n-5-formylpyridin-2-yl carbamate,2-boc-amino pyridine-5-carboxaldehyde,5-formyl-pyridin-2-yl-carbamic acid tert-butyl ester,5-formylpyridin-2-yl carbamic acid tert butyl ester,2-boc-aminopyridine-5-aldehyde,2-tert-butoxycarbonylamino pyridine-5-carboxaldehyde,carbamicacid, n-5-formyl-2-pyridinyl-, 1,1-dimethylethyl ester,6-aminonicotinaldehyde, 6-boc protected |
|---|---|
| Clave InChI | WZROBBWIJBBWQP-UHFFFAOYSA-N |
| PubChem CID | 22034247 |
| Fórmula molecular | C11H14N2O3 |
| CAS | 199296-40-7 |
| Peso molecular (g/mol) | 222.244 |
| Número MDL | MFCD08064228 |
| SMILES | CC(C)(C)OC(=O)NC1=NC=C(C=C1)C=O |
| Nombre IUPAC | N-(5-formilpiridin-2-il)carbamato de terc-butil |
Terc-butilmalonato de dietilo, 97 %, Thermo Scientific Chemicals
CAS: 759-24-0 Fórmula molecular: C11H20O4 Peso molecular (g/mol): 216.28 Número MDL: MFCD00009152 Clave InChI: RJNICNBRGVKNSR-UHFFFAOYSA-N Sinónimo: diethyl tert-butylmalonate,diethyl t-butylmalonate,diethyl 1,1-dimethylethyl malonate,diethyl 2-tert-butyl malonate,propanedioic acid, 1,1-dimethylethyl-, diethyl ester,diethyltert-butylmalonate,diethyl 2-tert-butylmalonate #,tert-butylmalonic acid diethyl ester,1,3-diethyl 2-tert-butylpropanedioate PubChem CID: 69798 Nombre IUPAC: 2-terc-butilpropanedioato de dietilo SMILES: CCOC(=O)C(C(=O)OCC)C(C)(C)C
| Sinónimo | diethyl tert-butylmalonate,diethyl t-butylmalonate,diethyl 1,1-dimethylethyl malonate,diethyl 2-tert-butyl malonate,propanedioic acid, 1,1-dimethylethyl-, diethyl ester,diethyltert-butylmalonate,diethyl 2-tert-butylmalonate #,tert-butylmalonic acid diethyl ester,1,3-diethyl 2-tert-butylpropanedioate |
|---|---|
| Clave InChI | RJNICNBRGVKNSR-UHFFFAOYSA-N |
| PubChem CID | 69798 |
| Fórmula molecular | C11H20O4 |
| CAS | 759-24-0 |
| Peso molecular (g/mol) | 216.28 |
| Número MDL | MFCD00009152 |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)(C)C |
| Nombre IUPAC | 2-terc-butilpropanedioato de dietilo |
malonato de etilo terc-butilo, 95 %, Thermo Scientific Chemicals
CAS: 32864-38-3 Fórmula molecular: C9H16O4 Peso molecular (g/mol): 188.223 Número MDL: MFCD00009193 Clave InChI: OCOBFMZGRJOSOU-UHFFFAOYSA-N Sinónimo: tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate PubChem CID: 96345 Nombre IUPAC: 3-O-terc-butilo 1-O-etil propanodioato SMILES: CCOC(=O)CC(=O)OC(C)(C)C
| Sinónimo | tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate |
|---|---|
| Clave InChI | OCOBFMZGRJOSOU-UHFFFAOYSA-N |
| PubChem CID | 96345 |
| Fórmula molecular | C9H16O4 |
| CAS | 32864-38-3 |
| Peso molecular (g/mol) | 188.223 |
| Número MDL | MFCD00009193 |
| SMILES | CCOC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | 3-O-terc-butilo 1-O-etil propanodioato |
4'-tert-Butilacetofenona, 98 %, Thermo Scientific Chemicals
CAS: 943-27-1 Fórmula molecular: C12H16O Peso molecular (g/mol): 176.259 Número MDL: MFCD00017256 Clave InChI: UYFJYGWNYQCHOB-UHFFFAOYSA-N Sinónimo: 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone PubChem CID: 13669 Nombre IUPAC: 1-(4-terc-butilfenil)etanona SMILES: CC(=O)C1=CC=C(C=C1)C(C)(C)C
| Sinónimo | 4'-tert-butylacetophenone,1-4-tert-butylphenyl ethanone,4-tert-butylacetophenone,1-4-tert-butyl phenyl ethanone,p-tert-butylacetophenone,ethanone, 1-4-1,1-dimethylethyl phenyl,acetophenone, 4'-tert-butyl,1-4-tert-butyl phenyl ethan-1-one,p-t-butylacetophenone,1-4-tert-butyl-phenyl-ethanone |
|---|---|
| Clave InChI | UYFJYGWNYQCHOB-UHFFFAOYSA-N |
| PubChem CID | 13669 |
| Fórmula molecular | C12H16O |
| CAS | 943-27-1 |
| Peso molecular (g/mol) | 176.259 |
| Número MDL | MFCD00017256 |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C)(C)C |
| Nombre IUPAC | 1-(4-terc-butilfenil)etanona |
4-(Boc-amino)indol-3-carboxaldehído, 97 %, Thermo Scientific Chemicals
CAS: 885266-77-3 Fórmula molecular: C14H16N2O3 Peso molecular (g/mol): 260.293 Número MDL: MFCD04973990 Clave InChI: XKYBSNNENLRYPN-UHFFFAOYSA-N Sinónimo: tert-butyl 3-formyl-1h-indol-4-ylcarbamate,tert-butyl n-3-formyl-1h-indol-4-yl carbamate,3-formyl-indol-4-yl-carbamic acid tert-butyl ester,3-formyl-1h-indol-4-yl-carbamic acid tert-butyl ester PubChem CID: 24720953 Nombre IUPAC: N-(3-formil-1H-indol-4-il)carbamato de terc-butilo SMILES: CC(C)(C)OC(=O)NC1=CC=CC2=C1C(=CN2)C=O
| Sinónimo | tert-butyl 3-formyl-1h-indol-4-ylcarbamate,tert-butyl n-3-formyl-1h-indol-4-yl carbamate,3-formyl-indol-4-yl-carbamic acid tert-butyl ester,3-formyl-1h-indol-4-yl-carbamic acid tert-butyl ester |
|---|---|
| Clave InChI | XKYBSNNENLRYPN-UHFFFAOYSA-N |
| PubChem CID | 24720953 |
| Fórmula molecular | C14H16N2O3 |
| CAS | 885266-77-3 |
| Peso molecular (g/mol) | 260.293 |
| Número MDL | MFCD04973990 |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC2=C1C(=CN2)C=O |
| Nombre IUPAC | N-(3-formil-1H-indol-4-il)carbamato de terc-butilo |
Terc-butilo metil malonato, 95 %, Thermo Scientific Chemicals
CAS: 42726-73-8 Fórmula molecular: C8H14O4 Peso molecular (g/mol): 174.2 Número MDL: MFCD00042856 Clave InChI: XPSYZCWYRWHVCC-UHFFFAOYSA-N Sinónimo: tert-butyl methyl malonate,t-butyl methyl malonate,1-tert-butyl 3-methyl propanedioate,acmc-20ajkv,tert-butyl methylmalote,pubchem20476,methyl tert-butyl malonate,ksc493c8h,tert-butyl methyl malonaoate PubChem CID: 2733872 Nombre IUPAC: 3-O-terc-butilo 1-O-metil propanodioato SMILES: CC(C)(C)OC(=O)CC(=O)OC
| Sinónimo | tert-butyl methyl malonate,t-butyl methyl malonate,1-tert-butyl 3-methyl propanedioate,acmc-20ajkv,tert-butyl methylmalote,pubchem20476,methyl tert-butyl malonate,ksc493c8h,tert-butyl methyl malonaoate |
|---|---|
| Clave InChI | XPSYZCWYRWHVCC-UHFFFAOYSA-N |
| PubChem CID | 2733872 |
| Fórmula molecular | C8H14O4 |
| CAS | 42726-73-8 |
| Peso molecular (g/mol) | 174.2 |
| Número MDL | MFCD00042856 |
| SMILES | CC(C)(C)OC(=O)CC(=O)OC |
| Nombre IUPAC | 3-O-terc-butilo 1-O-metil propanodioato |
Malonato de terc-butilo etilo, 97 %, Thermo Scientific Chemicals
CAS: 32864-38-3 Fórmula molecular: C9H16O4 Peso molecular (g/mol): 188.22 Número MDL: MFCD00009193 Clave InChI: OCOBFMZGRJOSOU-UHFFFAOYSA-N Sinónimo: tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate PubChem CID: 96345 Nombre IUPAC: 3-O-terc-butilo 1-O-etil propanodioato SMILES: CCOC(=O)CC(=O)OC(C)(C)C
| Sinónimo | tert-butyl ethyl malonate,t-butyl ethyl malonate,propanedioic acid, 1,1-dimethylethyl ethyl ester,1-tert-butyl 3-ethyl propanedioate,tert-butyl ethyl propanedioate,malonic acid tert-butyl ethyl ester,tert-butyl ethyl propane-1,3-dioate,zlchem 692,acmc-1cjju,1-tert-butyl ethyl malonate |
|---|---|
| Clave InChI | OCOBFMZGRJOSOU-UHFFFAOYSA-N |
| PubChem CID | 96345 |
| Fórmula molecular | C9H16O4 |
| CAS | 32864-38-3 |
| Peso molecular (g/mol) | 188.22 |
| Número MDL | MFCD00009193 |
| SMILES | CCOC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | 3-O-terc-butilo 1-O-etil propanodioato |
terc-Butil acetoacetato, 97 %, Thermo Scientific Chemicals
CAS: 1694-31-1 Fórmula molecular: C8H14O3 Peso molecular (g/mol): 158.197 Número MDL: MFCD00008811 Clave InChI: JKUYRAMKJLMYLO-UHFFFAOYSA-N Sinónimo: tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate PubChem CID: 15538 Nombre IUPAC: terc-butilo 3-oxobutanoato SMILES: CC(=O)CC(=O)OC(C)(C)C
| Sinónimo | tert-butyl acetoacetate,t-butyl acetoacetate,butanoic acid, 3-oxo-, 1,1-dimethylethyl ester,acetoacetic acid, tert-butyl ester,tert-butyl 3-oxobutyrate,acetoacetic acid tert-butyl ester,unii-1d3dos61gx,tbaa,1d3dos61gx,t-butylacetoacetate |
|---|---|
| Clave InChI | JKUYRAMKJLMYLO-UHFFFAOYSA-N |
| PubChem CID | 15538 |
| Fórmula molecular | C8H14O3 |
| CAS | 1694-31-1 |
| Peso molecular (g/mol) | 158.197 |
| Número MDL | MFCD00008811 |
| SMILES | CC(=O)CC(=O)OC(C)(C)C |
| Nombre IUPAC | terc-butilo 3-oxobutanoato |
3',5'-Di-terc-butil-4'-hidroxiacetofenona, 98 %, Thermo Scientific Chemicals
CAS: 14035-33-7 Fórmula molecular: C16H24O2 Peso molecular (g/mol): 248.37 Número MDL: MFCD00017520 Clave InChI: WGJPGMJLARWHRK-UHFFFAOYSA-N Sinónimo: 1-3,5-di-tert-butyl-4-hydroxyphenyl ethanone,1-3,5-ditert-butyl-4-hydroxyphenyl ethanone,1-3,5-di tert-butyl-4-hydroxyphenyl ethan-1-one,3',5'-di-tert-butyl-4'-hydroxyacetophenone,3,5-di-tert-butyl-4-hydroxyacetophenone,1-3,5-di-tert-butyl-4-hydroxyphenyl ethan-1-one,ethanone, 1-3,5-bis 1,1-dimethylethyl-4-hydroxyphenyl,1-3,5-bis 1,1-dimethylethyl-4-hydroxyphenyl ethanone,1-acetyl-3,5-bis tert-butyl-4-hydroxybenzene,cbmicro_019190 PubChem CID: 616296 Nombre IUPAC: 1-(3,5-diterc-butil-4-hidroxifenil)etanona SMILES: CC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C
| Sinónimo | 1-3,5-di-tert-butyl-4-hydroxyphenyl ethanone,1-3,5-ditert-butyl-4-hydroxyphenyl ethanone,1-3,5-di tert-butyl-4-hydroxyphenyl ethan-1-one,3',5'-di-tert-butyl-4'-hydroxyacetophenone,3,5-di-tert-butyl-4-hydroxyacetophenone,1-3,5-di-tert-butyl-4-hydroxyphenyl ethan-1-one,ethanone, 1-3,5-bis 1,1-dimethylethyl-4-hydroxyphenyl,1-3,5-bis 1,1-dimethylethyl-4-hydroxyphenyl ethanone,1-acetyl-3,5-bis tert-butyl-4-hydroxybenzene,cbmicro_019190 |
|---|---|
| Clave InChI | WGJPGMJLARWHRK-UHFFFAOYSA-N |
| PubChem CID | 616296 |
| Fórmula molecular | C16H24O2 |
| CAS | 14035-33-7 |
| Peso molecular (g/mol) | 248.37 |
| Número MDL | MFCD00017520 |
| SMILES | CC(=O)C1=CC(=C(O)C(=C1)C(C)(C)C)C(C)(C)C |
| Nombre IUPAC | 1-(3,5-diterc-butil-4-hidroxifenil)etanona |