Sulfóxidos
- (2)
- (3)
- (2)
- (1)
- (3)
- (2)
- (3)
- (2)
- (2)
- (1)
- (2)
- (2)
- (3)
- (4)
- (2)
- (2)
- (3)
- (3)
- (1)
- (1)
- (3)
- (3)
- (1)
- (2)
- (3)
- (1)
- (6)
- (1)
- (1)
- (2)
- (5)
- (4)
- (2)
- (2)
- (2)
- (6)
- (1)
- (2)
- (1)
- (3)
- (7)
- (1)
- (5)
- (1)
- (3)
- (2)
- (6)
- (8)
- (2)
- (1)
- (2)
- (12)
- (4)
- (3)
- (2)
- (1)
- (3)
- (2)
- (1)
- (2)
- (3)
- (2)
- (1)
- (2)
- (2)
- (3)
- (4)
- (2)
- (3)
- (1)
Resultados de la búsqueda filtrada
1-Óxido de tetrahidrotiofeno, 97 %, Thermo Scientific Chemicals
CAS: 1600-44-8 Fórmula molecular: C4H8OS Peso molecular (g/mol): 104.167 Número MDL: MFCD00005477 Clave InChI: ISXOBTBCNRIIQO-UHFFFAOYSA-N Sinónimo: tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide PubChem CID: 1128 Nombre IUPAC: 1-óxido de tiolano SMILES: C1CCS(=O)C1
| Sinónimo | tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide |
|---|---|
| Clave InChI | ISXOBTBCNRIIQO-UHFFFAOYSA-N |
| PubChem CID | 1128 |
| Fórmula molecular | C4H8OS |
| CAS | 1600-44-8 |
| Peso molecular (g/mol) | 104.167 |
| Número MDL | MFCD00005477 |
| SMILES | C1CCS(=O)C1 |
| Nombre IUPAC | 1-óxido de tiolano |
Tetrametileno sulfóxido, 97 %, Thermo Scientific Chemicals
CAS: 1600-44-8 Fórmula molecular: C4H8OS Peso molecular (g/mol): 104.17 Número MDL: MFCD00005477 Clave InChI: ISXOBTBCNRIIQO-UHFFFAOYSA-N Sinónimo: tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide PubChem CID: 1128 Nombre IUPAC: 1-óxido de tiolano SMILES: C1CCS(=O)C1
| Sinónimo | tetramethylene sulfoxide,tetrahydrothiophene 1-oxide,thiophane oxide,tetrahydrothiophene oxide,thiophane monoxide,thiophane 1-oxide,thiophene, tetrahydro-, 1-oxide,tetramethylene sulphoxide,thiophene, tetrahydro, 1-oxide,tetrametylene sulfoxide |
|---|---|
| Clave InChI | ISXOBTBCNRIIQO-UHFFFAOYSA-N |
| PubChem CID | 1128 |
| Fórmula molecular | C4H8OS |
| CAS | 1600-44-8 |
| Peso molecular (g/mol) | 104.17 |
| Número MDL | MFCD00005477 |
| SMILES | C1CCS(=O)C1 |
| Nombre IUPAC | 1-óxido de tiolano |
Metil fenil sulfóxido, 98+ %, Thermo Scientific Chemicals
CAS: 1193-82-4 Fórmula molecular: C7H8OS Peso molecular (g/mol): 140.21 Número MDL: MFCD00002088 Clave InChI: JXTGICXCHWMCPM-UHFFFAOYSA-N Sinónimo: methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene PubChem CID: 14516 Nombre IUPAC: metilsulfinilbenceno SMILES: CS(=O)C1=CC=CC=C1
| Sinónimo | methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene |
|---|---|
| Clave InChI | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| PubChem CID | 14516 |
| Fórmula molecular | C7H8OS |
| CAS | 1193-82-4 |
| Peso molecular (g/mol) | 140.21 |
| Número MDL | MFCD00002088 |
| SMILES | CS(=O)C1=CC=CC=C1 |
| Nombre IUPAC | metilsulfinilbenceno |
Metil p-tolil sulfóxido, 98 %, Thermo Scientific Chemicals
CAS: 934-72-5 Fórmula molecular: C8H10OS Peso molecular (g/mol): 154.23 Número MDL: MFCD00075175 Clave InChI: FEVALTJSQBFLEU-UHFFFAOYNA-N Sinónimo: 1-methyl-4-methylsulfinyl benzene,methyl 4-methylphenylsulfoxide,methyl p-tolyl sulfoxide,1-methanesulfinyl-4-methylbenzene,methyl p-methylphenylsulfoxide,1-methyl-4-methylsulphinyl benzene,benzene, 1-methyl-4-methylsulfinyl,acmc-20aotg,acmc-20apjq,methyl p-tolylsulfoxide PubChem CID: 136743 Nombre IUPAC: 1-metil-4-metilsulfinilbenceno SMILES: CC1=CC=C(C=C1)S(C)=O
| Sinónimo | 1-methyl-4-methylsulfinyl benzene,methyl 4-methylphenylsulfoxide,methyl p-tolyl sulfoxide,1-methanesulfinyl-4-methylbenzene,methyl p-methylphenylsulfoxide,1-methyl-4-methylsulphinyl benzene,benzene, 1-methyl-4-methylsulfinyl,acmc-20aotg,acmc-20apjq,methyl p-tolylsulfoxide |
|---|---|
| Clave InChI | FEVALTJSQBFLEU-UHFFFAOYNA-N |
| PubChem CID | 136743 |
| Fórmula molecular | C8H10OS |
| CAS | 934-72-5 |
| Peso molecular (g/mol) | 154.23 |
| Número MDL | MFCD00075175 |
| SMILES | CC1=CC=C(C=C1)S(C)=O |
| Nombre IUPAC | 1-metil-4-metilsulfinilbenceno |
Sulfóxido de difenilo, +98 %, Thermo Scientific Chemicals
CAS: 945-51-7 Fórmula molecular: C12H10OS Peso molecular (g/mol): 202.271 Número MDL: MFCD00002085 Clave InChI: JJHHIJFTHRNPIK-UHFFFAOYSA-N Sinónimo: diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene PubChem CID: 13679 Nombre IUPAC: bencenosulfinilbenceno SMILES: C1=CC=C(C=C1)S(=O)C2=CC=CC=C2
| Sinónimo | diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene |
|---|---|
| Clave InChI | JJHHIJFTHRNPIK-UHFFFAOYSA-N |
| PubChem CID | 13679 |
| Fórmula molecular | C12H10OS |
| CAS | 945-51-7 |
| Peso molecular (g/mol) | 202.271 |
| Número MDL | MFCD00002085 |
| SMILES | C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 |
| Nombre IUPAC | bencenosulfinilbenceno |
Sulfóxido de di-n-butilo, 97 %, Thermo Scientific Chemicals
CAS: 2168-93-6 Fórmula molecular: C8H18OS Peso molecular (g/mol): 162.291 Número MDL: MFCD00002093 Clave InChI: LOWMYOWHQMKBTM-UHFFFAOYSA-N Sinónimo: dibutyl sulfoxide,butyl sulfoxide,n-butyl sulfoxide,dibutyl sulphoxide,di-n-butyl sulfoxide,butane, 1,1'-sulfinylbis,sulfoxide, dibutyl,di-n-butylsulfoxide,butane,1-butylsulfinyl,butylsulfinyl butane PubChem CID: 16568 Nombre IUPAC: 1-butilsulfinilbutano SMILES: CCCCS(=O)CCCC
| Sinónimo | dibutyl sulfoxide,butyl sulfoxide,n-butyl sulfoxide,dibutyl sulphoxide,di-n-butyl sulfoxide,butane, 1,1'-sulfinylbis,sulfoxide, dibutyl,di-n-butylsulfoxide,butane,1-butylsulfinyl,butylsulfinyl butane |
|---|---|
| Clave InChI | LOWMYOWHQMKBTM-UHFFFAOYSA-N |
| PubChem CID | 16568 |
| Fórmula molecular | C8H18OS |
| CAS | 2168-93-6 |
| Peso molecular (g/mol) | 162.291 |
| Número MDL | MFCD00002093 |
| SMILES | CCCCS(=O)CCCC |
| Nombre IUPAC | 1-butilsulfinilbutano |
Metil fenil sulfóxido, 98+ %, Thermo Scientific Chemicals
CAS: 1193-82-4 Fórmula molecular: C7H8OS Peso molecular (g/mol): 140.2 Número MDL: MFCD00002088 Clave InChI: JXTGICXCHWMCPM-UHFFFAOYSA-N Sinónimo: methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene PubChem CID: 14516 Nombre IUPAC: metilsulfinilbenceno SMILES: CS(=O)C1=CC=CC=C1
| Sinónimo | methyl phenyl sulfoxide,methylsulfinyl benzene,thioanisole s-oxide,phenyl methyl sulfoxide,sulfoxide, methyl phenyl,benzene, methylsulfinyl,methanesulfinylbenzene,methylphenylsulfoxide,methylsulphinyl benzene |
|---|---|
| Clave InChI | JXTGICXCHWMCPM-UHFFFAOYSA-N |
| PubChem CID | 14516 |
| Fórmula molecular | C7H8OS |
| CAS | 1193-82-4 |
| Peso molecular (g/mol) | 140.2 |
| Número MDL | MFCD00002088 |
| SMILES | CS(=O)C1=CC=CC=C1 |
| Nombre IUPAC | metilsulfinilbenceno |
Ácido 2-(metilsulfinil)bencenoborónico, 97 %, Thermo Scientific Chemicals
CAS: 850567-97-4 Fórmula molecular: C7H9BO3S Peso molecular (g/mol): 184.02 Número MDL: MFCD03095261 Clave InChI: PHORKVSBWZGTEX-UHFFFAOYNA-N Sinónimo: 2-methylsulfinyl phenylboronic acid,2-methylsulfinyl phenyl boronic acid,2-methylsulfinylphenyl boronic acid,2-methylsulphinyl benzeneboronic acid,2-methanesulfinylphenylboronic acid,1-borono-2-methylsulphinyl benzene,2-methylsulfinyl benzeneboronic acid,pubchem1874,acmc-209q0z PubChem CID: 2773529 Nombre IUPAC: ácido (2-metilsulfinilfenil)borónico SMILES: CS(=O)C1=CC=CC=C1B(O)O
| Sinónimo | 2-methylsulfinyl phenylboronic acid,2-methylsulfinyl phenyl boronic acid,2-methylsulfinylphenyl boronic acid,2-methylsulphinyl benzeneboronic acid,2-methanesulfinylphenylboronic acid,1-borono-2-methylsulphinyl benzene,2-methylsulfinyl benzeneboronic acid,pubchem1874,acmc-209q0z |
|---|---|
| Clave InChI | PHORKVSBWZGTEX-UHFFFAOYNA-N |
| PubChem CID | 2773529 |
| Fórmula molecular | C7H9BO3S |
| CAS | 850567-97-4 |
| Peso molecular (g/mol) | 184.02 |
| Número MDL | MFCD03095261 |
| SMILES | CS(=O)C1=CC=CC=C1B(O)O |
| Nombre IUPAC | ácido (2-metilsulfinilfenil)borónico |
Fenil sulfóxido, 97 %, Thermo Scientific Chemicals
CAS: 945-51-7 Fórmula molecular: C12H10OS Peso molecular (g/mol): 202.27 Número MDL: MFCD00002085 Clave InChI: JJHHIJFTHRNPIK-UHFFFAOYSA-N Sinónimo: diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene PubChem CID: 13679 Nombre IUPAC: bencenosulfinilbenceno SMILES: C1=CC=C(C=C1)S(=O)C2=CC=CC=C2
| Sinónimo | diphenyl sulfoxide,phenyl sulfoxide,sulfinyldibenzene,phenylsulfinylbenzene,diphenyl sulphoxide,sulfoxide, diphenyl,diphenylsulfoxide,benzene, 1,1'-sulfinylbis,1,1'-sulfinyldibenzene,phenylsulfinyl benzene |
|---|---|
| Clave InChI | JJHHIJFTHRNPIK-UHFFFAOYSA-N |
| PubChem CID | 13679 |
| Fórmula molecular | C12H10OS |
| CAS | 945-51-7 |
| Peso molecular (g/mol) | 202.27 |
| Número MDL | MFCD00002085 |
| SMILES | C1=CC=C(C=C1)S(=O)C2=CC=CC=C2 |
| Nombre IUPAC | bencenosulfinilbenceno |
Ácido 4-(metilsulfinil)bencenoborónico, 98 %, Thermo Scientific Chemicals
CAS: 166386-48-7 Fórmula molecular: C7H9BO3S Peso molecular (g/mol): 184.02 Número MDL: MFCD02093071 Clave InChI: YOTGALZTDVXUKZ-UHFFFAOYNA-N Sinónimo: 4-methanesulfinyl benzeneboronic acid,4-methylsulfinyl phenyl boronic acid,4-methylsulphinyl benzeneboronic acid,4-methylsulfinylphenyl boronic acid,4-methanesulphinylphenylboronic acid,4-methylsulfinyl phenylboronic acid,boronic acid, 4-methylsulfinyl phenyl,4-boronophenyl methyl sulfoxide,4-methanesulfinylphenylboronic acid PubChem CID: 2773531 Nombre IUPAC: ácido (4-metilsulfinilfenil)borónico SMILES: CS(=O)C1=CC=C(C=C1)B(O)O
| Sinónimo | 4-methanesulfinyl benzeneboronic acid,4-methylsulfinyl phenyl boronic acid,4-methylsulphinyl benzeneboronic acid,4-methylsulfinylphenyl boronic acid,4-methanesulphinylphenylboronic acid,4-methylsulfinyl phenylboronic acid,boronic acid, 4-methylsulfinyl phenyl,4-boronophenyl methyl sulfoxide,4-methanesulfinylphenylboronic acid |
|---|---|
| Clave InChI | YOTGALZTDVXUKZ-UHFFFAOYNA-N |
| PubChem CID | 2773531 |
| Fórmula molecular | C7H9BO3S |
| CAS | 166386-48-7 |
| Peso molecular (g/mol) | 184.02 |
| Número MDL | MFCD02093071 |
| SMILES | CS(=O)C1=CC=C(C=C1)B(O)O |
| Nombre IUPAC | ácido (4-metilsulfinilfenil)borónico |
Demeton-S Sulfóxido, TRC
CAS: 2496-92-6 Fórmula molecular: C8 H19 O4 P S2 Peso molecular (g/mol): 274.34 Sinónimo: Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide Nombre IUPAC: 1-dietoxoxifosforilsulfanil-2-etilsulfiniletanolo SMILES: CCOP(=O)(OCC)SCCS(=O)CC
| Sinónimo | Phosphorothioic acid, O,O-diethyl S-[2-(ethylsulfinyl)ethyl] ester,Ethanethiol, 2-(ethylsulfinyl)-, S-ester with O,O-diethyl phosphorothioate (8CI),Demeton-S sulfoxide,Isosystox sulfoxide,O,O-Diethyl S-[2-(ethylsulfinyl)ethyl] phosphorothioate,Systox sulfoxide |
|---|---|
| Fórmula molecular | C8 H19 O4 P S2 |
| CAS | 2496-92-6 |
| Peso molecular (g/mol) | 274.34 |
| SMILES | CCOP(=O)(OCC)SCCS(=O)CC |
| Nombre IUPAC | 1-dietoxoxifosforilsulfanil-2-etilsulfiniletanolo |
Oxóxido de oxón forato, TRC
CAS: 2588-05-8 Fórmula molecular: C7 H17 O4 P S2 Peso molecular (g/mol): 260.31 Sinónimo: Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate Nombre IUPAC: 1-[etoxi(etilsulfinilmetilsulfanilo)fosforiloxiletano]oxietano SMILES: CCOP(=O)(OCC)SCS(=O)CC
| Sinónimo | Phorate oxon sulfoxide,O,O-Diethyl S-(ethylsulfinyl)methyl phosphorothioate |
|---|---|
| Fórmula molecular | C7 H17 O4 P S2 |
| CAS | 2588-05-8 |
| Peso molecular (g/mol) | 260.31 |
| SMILES | CCOP(=O)(OCC)SCS(=O)CC |
| Nombre IUPAC | 1-[etoxi(etilsulfinilmetilsulfanilo)fosforiloxiletano]oxietano |