Isobenzofuranos
- (3)
- (2)
- (5)
- (6)
- (5)
- (3)
- (7)
- (9)
- (2)
- (2)
- (2)
- (3)
- (2)
- (2)
- (3)
- (2)
- (3)
- (4)
- (2)
- (1)
- (11)
- (1)
- (1)
- (1)
- (3)
- (1)
- (10)
- (1)
- (3)
- (2)
- (1)
- (9)
- (2)
- (1)
- (7)
- (2)
- (2)
- (1)
- (3)
- (6)
- (14)
- (8)
- (6)
- (1)
- (2)
- (9)
- (3)
- (2)
- (3)
- (2)
- (2)
- (3)
- (6)
- (3)
Resultados de la búsqueda filtrada
Thermo Scientific Chemicals Diacetato de fluoresceína, 97 %, puro
CAS: 596-09-8 Fórmula molecular: C24H16O7 Peso molecular (g/mol): 416.39 Número MDL: MFCD00005062 Clave InChI: CHADEQDQBURGHL-UHFFFAOYSA-N Sinónimo: fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate PubChem CID: 65047 Nombre IUPAC: (6'-acetiloxi-3-oxospiro[2-benzofuran-1,9'-xanten]-3'-il) acetato SMILES: CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | fluorescein diacetate,3,6-diacetoxyfluoran,diacetylfluorescein,di-o-acetylfluorescein,fluorescein, diacetate,3',6'-diacetylfluorescein,unii-yl39r93pre,yl39r93pre,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 3',6'-bis acetyloxy,3-oxo-3h-spiro isobenzofuran-1,9'-xanthene-3',6'-diyl diacetate |
|---|---|
| Clave InChI | CHADEQDQBURGHL-UHFFFAOYSA-N |
| PubChem CID | 65047 |
| Fórmula molecular | C24H16O7 |
| CAS | 596-09-8 |
| Peso molecular (g/mol) | 416.39 |
| Número MDL | MFCD00005062 |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=CC=CC=C5C(=O)O3 |
| Nombre IUPAC | (6'-acetiloxi-3-oxospiro[2-benzofuran-1,9'-xanten]-3'-il) acetato |
Thermo Scientific Chemicals Fluoresceína, 90+%
CAS: 2321-07-5 Fórmula molecular: C20H12O5 Peso molecular (g/mol): 332.31 Número MDL: MFCD00005050 Clave InChI: GNBHRKFJIUUOQI-UHFFFAOYSA-N Sinónimo: fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 PubChem CID: 16850 ChEBI: CHEBI:31624 Nombre IUPAC: 3',6'-dihidroxispiro[2-benzofuran-3,9'-xanten]-1-ona SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | fluorescein,solvent yellow 94,resorcinolphthalein,yellow fluorescein,3,6-fluorandiol,d and c yellow no. 7,fluoresceine,japan yellow 201,c.i. solvent yellow 94,d&c yellow no. 7 |
|---|---|
| Clave InChI | GNBHRKFJIUUOQI-UHFFFAOYSA-N |
| PubChem CID | 16850 |
| Fórmula molecular | C20H12O5 |
| CAS | 2321-07-5 |
| ChEBI | CHEBI:31624 |
| Peso molecular (g/mol) | 332.31 |
| Número MDL | MFCD00005050 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Nombre IUPAC | 3',6'-dihidroxispiro[2-benzofuran-3,9'-xanten]-1-ona |
Anhídido de 1,2-ciclohexanodicarboxílico, cis + trans, 97 %, Thermo Scientific Chemicals
CAS: 85-42-7 Fórmula molecular: C8H10O3 Peso molecular (g/mol): 154.17 Número MDL: MFCD00064863,MFCD00674195 Clave InChI: MUTGBJKUEZFXGO-UHFFFAOYNA-N Sinónimo: hexahydrophthalic anhydride,hexahydroisobenzofuran-1,3-dione,hhpa,1,2-cyclohexanedicarboxylic anhydride,lekutherm hardener h,hexahydrophthalic acid anhydride,1,3-isobenzofurandione, hexahydro,araldite ht 907,cyclohexane-1,2-dicarboxylic anhydride,1,2-cyclohexanedicarboxylic acid anhydride PubChem CID: 85689 ChEBI: CHEBI:103210 Nombre IUPAC: octahydro-2-benzofuran-1,3-dione SMILES: O=C1OC(=O)C2CCCCC12
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | hexahydrophthalic anhydride,hexahydroisobenzofuran-1,3-dione,hhpa,1,2-cyclohexanedicarboxylic anhydride,lekutherm hardener h,hexahydrophthalic acid anhydride,1,3-isobenzofurandione, hexahydro,araldite ht 907,cyclohexane-1,2-dicarboxylic anhydride,1,2-cyclohexanedicarboxylic acid anhydride |
|---|---|
| Clave InChI | MUTGBJKUEZFXGO-UHFFFAOYNA-N |
| PubChem CID | 85689 |
| Fórmula molecular | C8H10O3 |
| CAS | 85-42-7 |
| ChEBI | CHEBI:103210 |
| Peso molecular (g/mol) | 154.17 |
| Número MDL | MFCD00064863,MFCD00674195 |
| SMILES | O=C1OC(=O)C2CCCCC12 |
| Nombre IUPAC | octahydro-2-benzofuran-1,3-dione |
Thermo Scientific Chemicals Isotiocianato de fluoresceína, isómero 1, 95 %
CAS: 3326-32-7 Fórmula molecular: C21H11NO5S Peso molecular (g/mol): 389.381 Número MDL: MFCD00005063 Clave InChI: MHMNJMPURVTYEJ-UHFFFAOYSA-N Sinónimo: fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer PubChem CID: 18730 ChEBI: CHEBI:37918 Nombre IUPAC: 3',6'-dihidroxi-6-isotiocianatospiro[2-benzofurano-3,9'-xanten]-1-ona SMILES: C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | fitc,fluorescein isothiocyanate isomer i,5-isothiocyanatofluorescein,fluorescein 5-isothiocyanate,5-fitc,fluorescein-5-isothiocyanate,fluorescein 5 6-isothiocyanate,fitc isomer 1,unii-i223nx31w9,fitc isomer |
|---|---|
| Clave InChI | MHMNJMPURVTYEJ-UHFFFAOYSA-N |
| PubChem CID | 18730 |
| Fórmula molecular | C21H11NO5S |
| CAS | 3326-32-7 |
| ChEBI | CHEBI:37918 |
| Peso molecular (g/mol) | 389.381 |
| Número MDL | MFCD00005063 |
| SMILES | C1=CC2=C(C=C1N=C=S)C(=O)OC23C4=C(C=C(C=C4)O)OC5=C3C=CC(=C5)O |
| Nombre IUPAC | 3',6'-dihidroxi-6-isotiocianatospiro[2-benzofurano-3,9'-xanten]-1-ona |
Thermo Scientific Chemicals Rosa bengala
CAS: 632-69-9 Fórmula molecular: C20H4Cl4I4Na2O5 Peso molecular (g/mol): 1019.644 Número MDL: MFCD00151169 Clave InChI: DPBQSRZQYAYDGY-UHFFFAOYSA-N Sinónimo: rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin PubChem CID: 87244310 Nombre IUPAC: sodio;4,5,6,7-tetracloro-3',6'-dihidroxi-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanteno]-1-ona SMILES: C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na]
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | rose bengal disodium salt,r105 sodium,rose bengal sodium,rose-bengal 131 i natrium,food red no. 105, sodium salt,food red color no. 105, sodium salt,rosa bengala sodica 131 i inn-spanish,rose bengale 131 i sodique inn-french,sel disodique de rose bengale iodee 131 i,roseum bengalense 131 i natricum inn-latin |
|---|---|
| Clave InChI | DPBQSRZQYAYDGY-UHFFFAOYSA-N |
| PubChem CID | 87244310 |
| Fórmula molecular | C20H4Cl4I4Na2O5 |
| CAS | 632-69-9 |
| Peso molecular (g/mol) | 1019.644 |
| Número MDL | MFCD00151169 |
| SMILES | C1=C2C(=C(C(=C1I)O)I)OC3=C(C(=C(C=C3C24C5=C(C(=C(C(=C5Cl)Cl)Cl)Cl)C(=O)O4)I)O)I.[Na].[Na] |
| Nombre IUPAC | sodio;4,5,6,7-tetracloro-3',6'-dihidroxi-2',4',5',7'-tetraiodospiro[2-benzofuran-3,9'-xanteno]-1-ona |
2',7'-Diclorofluoresceína, Thermo Scientific Chemicals
CAS: 76-54-0 Fórmula molecular: C20H10Cl2O5 Peso molecular (g/mol): 401.195 Número MDL: MFCD00005047 Clave InChI: VFNKZQNIXUFLBC-UHFFFAOYSA-N Sinónimo: 2',7'-dichlorofluorescein,dichlorofluorescein,unii-56nqm5uzt1,2,7-dichlorofluorescein,56nqm5uzt1,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 2',7'-dichloro-3',6'-dihydroxy,2',7'-dichloro-3',6'-dihydroxy-3h-spiro isobenzofuran-1,9'-xanthen-3-one,2',7'-dichloro-3',6'-dihydroxyspiro 2-benzofuran-3,9'-xanthene-1-one,11,16-dichloro-12,15-dihydroxyspiro 3-hydroisobenzofuran-3,9'-xanthene-1-one PubChem CID: 64944 ChEBI: CHEBI:51596 Nombre IUPAC: 2',7'-dicloro-3',6'-dihidroxispiro[2-benzofuran-3,9'-xanten]-1-ona SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl
| Sinónimo | 2',7'-dichlorofluorescein,dichlorofluorescein,unii-56nqm5uzt1,2,7-dichlorofluorescein,56nqm5uzt1,spiro isobenzofuran-1 3h ,9'-9h xanthen-3-one, 2',7'-dichloro-3',6'-dihydroxy,2',7'-dichloro-3',6'-dihydroxy-3h-spiro isobenzofuran-1,9'-xanthen-3-one,2',7'-dichloro-3',6'-dihydroxyspiro 2-benzofuran-3,9'-xanthene-1-one,11,16-dichloro-12,15-dihydroxyspiro 3-hydroisobenzofuran-3,9'-xanthene-1-one |
|---|---|
| Clave InChI | VFNKZQNIXUFLBC-UHFFFAOYSA-N |
| PubChem CID | 64944 |
| Fórmula molecular | C20H10Cl2O5 |
| CAS | 76-54-0 |
| ChEBI | CHEBI:51596 |
| Peso molecular (g/mol) | 401.195 |
| Número MDL | MFCD00005047 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=CC(=C(C=C4OC5=CC(=C(C=C35)Cl)O)O)Cl |
| Nombre IUPAC | 2',7'-dicloro-3',6'-dihidroxispiro[2-benzofuran-3,9'-xanten]-1-ona |
Dianhídrido piromelítico, 97 %, Thermo Scientific Chemicals
CAS: 89-32-7 Fórmula molecular: C10H2O6 Peso molecular (g/mol): 218.12 Número MDL: MFCD00005005 Clave InChI: ANSXAPJVJOKRDJ-UHFFFAOYSA-N Sinónimo: pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride PubChem CID: 6966 Nombre IUPAC: furo[3,4-f][2]benzofurano-1,3,5,7-tetrona SMILES: O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O
| Sinónimo | pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride |
|---|---|
| Clave InChI | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| PubChem CID | 6966 |
| Fórmula molecular | C10H2O6 |
| CAS | 89-32-7 |
| Peso molecular (g/mol) | 218.12 |
| Número MDL | MFCD00005005 |
| SMILES | O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O |
| Nombre IUPAC | furo[3,4-f][2]benzofurano-1,3,5,7-tetrona |
1,3-Difenilisobenzofurano, 97 %, Thermo Scientific Chemicals
CAS: 5471-63-6 Fórmula molecular: C20H14O Peso molecular (g/mol): 270.32 Número MDL: MFCD00005931 Clave InChI: ZKSVYBRJSMBDMV-UHFFFAOYSA-N Sinónimo: 1,3-diphenylisobenzofuran,diphenylisobenzofuran,isobenzofuran, 1,3-diphenyl,1,3 diphenylisobenzofuran,2,5-diphenyl-3,4-benzofuran,acmc-209lj9,1,3-diphenylbenzo c furan,1,3-diphenylisobenzo b furan,1,3-di phenyl-2-benzofuran,# PubChem CID: 21649 Nombre IUPAC: 1,3-difenil-2-benzofurano SMILES: C1=CC=C(C=C1)C2=C3C=CC=CC3=C(O2)C4=CC=CC=C4
| Sinónimo | 1,3-diphenylisobenzofuran,diphenylisobenzofuran,isobenzofuran, 1,3-diphenyl,1,3 diphenylisobenzofuran,2,5-diphenyl-3,4-benzofuran,acmc-209lj9,1,3-diphenylbenzo c furan,1,3-diphenylisobenzo b furan,1,3-di phenyl-2-benzofuran,# |
|---|---|
| Clave InChI | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| PubChem CID | 21649 |
| Fórmula molecular | C20H14O |
| CAS | 5471-63-6 |
| Peso molecular (g/mol) | 270.32 |
| Número MDL | MFCD00005931 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(O2)C4=CC=CC=C4 |
| Nombre IUPAC | 1,3-difenil-2-benzofurano |
1,3-Difenilisobenzofurano, 97 %, Thermo Scientific Chemicals
CAS: 5471-63-6 Fórmula molecular: C20H14O Peso molecular (g/mol): 270.331 Número MDL: MFCD00005931 Clave InChI: ZKSVYBRJSMBDMV-UHFFFAOYSA-N Sinónimo: 1,3-diphenylisobenzofuran,diphenylisobenzofuran,isobenzofuran, 1,3-diphenyl,1,3 diphenylisobenzofuran,2,5-diphenyl-3,4-benzofuran,acmc-209lj9,1,3-diphenylbenzo c furan,1,3-diphenylisobenzo b furan,1,3-di phenyl-2-benzofuran,# PubChem CID: 21649 Nombre IUPAC: 1,3-difenil-2-benzofurano SMILES: C1=CC=C(C=C1)C2=C3C=CC=CC3=C(O2)C4=CC=CC=C4
| Sinónimo | 1,3-diphenylisobenzofuran,diphenylisobenzofuran,isobenzofuran, 1,3-diphenyl,1,3 diphenylisobenzofuran,2,5-diphenyl-3,4-benzofuran,acmc-209lj9,1,3-diphenylbenzo c furan,1,3-diphenylisobenzo b furan,1,3-di phenyl-2-benzofuran,# |
|---|---|
| Clave InChI | ZKSVYBRJSMBDMV-UHFFFAOYSA-N |
| PubChem CID | 21649 |
| Fórmula molecular | C20H14O |
| CAS | 5471-63-6 |
| Peso molecular (g/mol) | 270.331 |
| Número MDL | MFCD00005931 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=C(O2)C4=CC=CC=C4 |
| Nombre IUPAC | 1,3-difenil-2-benzofurano |
Anhídrido 3,4,5,6-tetrahidroftálico, 98 %, Thermo Scientific Chemicals
CAS: 2426-02-0 Fórmula molecular: C8H8O3 Peso molecular (g/mol): 152.15 Número MDL: MFCD00005917 Clave InChI: HMMBJOWWRLZEMI-UHFFFAOYSA-N Sinónimo: 3,4,5,6-tetrahydrophthalic anhydride,4,5,6,7-tetrahydroisobenzofuran-1,3-dione,1-cyclohexene-1,2-dicarboxylic anhydride,1,3-isobenzofurandione, 4,5,6,7-tetrahydro,unii-01d3m89a2w,cyclohexene-1,2-dicarboxylic anhydride,3,4,5,6-tetrahydrophthalic acid anhydride,1,3,4,5,6,7-hexahydro-2-benzofuran-1,3-dione,1, 4,5,6,7-tetrahydro,4,5,6,7-tetrahydro-1,3-isobenzofurandione PubChem CID: 12475 SMILES: O=C1OC(=O)C2=C1CCCC2
| Sinónimo | 3,4,5,6-tetrahydrophthalic anhydride,4,5,6,7-tetrahydroisobenzofuran-1,3-dione,1-cyclohexene-1,2-dicarboxylic anhydride,1,3-isobenzofurandione, 4,5,6,7-tetrahydro,unii-01d3m89a2w,cyclohexene-1,2-dicarboxylic anhydride,3,4,5,6-tetrahydrophthalic acid anhydride,1,3,4,5,6,7-hexahydro-2-benzofuran-1,3-dione,1, 4,5,6,7-tetrahydro,4,5,6,7-tetrahydro-1,3-isobenzofurandione |
|---|---|
| Clave InChI | HMMBJOWWRLZEMI-UHFFFAOYSA-N |
| PubChem CID | 12475 |
| Fórmula molecular | C8H8O3 |
| CAS | 2426-02-0 |
| Peso molecular (g/mol) | 152.15 |
| Número MDL | MFCD00005917 |
| SMILES | O=C1OC(=O)C2=C1CCCC2 |
Anhídrido 1-ciclohexeno-1,2-dicarboxílico,97+ %, Thermo Scientific Chemicals
CAS: 2426-02-0 Fórmula molecular: C8H8O3 Peso molecular (g/mol): 152.15 Número MDL: MFCD00005917 Clave InChI: HMMBJOWWRLZEMI-UHFFFAOYSA-N Sinónimo: 3,4,5,6-tetrahydrophthalic anhydride,4,5,6,7-tetrahydroisobenzofuran-1,3-dione,1-cyclohexene-1,2-dicarboxylic anhydride,1,3-isobenzofurandione, 4,5,6,7-tetrahydro,unii-01d3m89a2w,cyclohexene-1,2-dicarboxylic anhydride,3,4,5,6-tetrahydrophthalic acid anhydride,1,3,4,5,6,7-hexahydro-2-benzofuran-1,3-dione,1, 4,5,6,7-tetrahydro,4,5,6,7-tetrahydro-1,3-isobenzofurandione PubChem CID: 12475 Nombre IUPAC: 4,5,6,7-tetrahidro-2-benzofurano-1,3-diona SMILES: O=C1OC(=O)C2=C1CCCC2
| Sinónimo | 3,4,5,6-tetrahydrophthalic anhydride,4,5,6,7-tetrahydroisobenzofuran-1,3-dione,1-cyclohexene-1,2-dicarboxylic anhydride,1,3-isobenzofurandione, 4,5,6,7-tetrahydro,unii-01d3m89a2w,cyclohexene-1,2-dicarboxylic anhydride,3,4,5,6-tetrahydrophthalic acid anhydride,1,3,4,5,6,7-hexahydro-2-benzofuran-1,3-dione,1, 4,5,6,7-tetrahydro,4,5,6,7-tetrahydro-1,3-isobenzofurandione |
|---|---|
| Clave InChI | HMMBJOWWRLZEMI-UHFFFAOYSA-N |
| PubChem CID | 12475 |
| Fórmula molecular | C8H8O3 |
| CAS | 2426-02-0 |
| Peso molecular (g/mol) | 152.15 |
| Número MDL | MFCD00005917 |
| SMILES | O=C1OC(=O)C2=C1CCCC2 |
| Nombre IUPAC | 4,5,6,7-tetrahidro-2-benzofurano-1,3-diona |
Anhídrido 1,2,4,5-bencenotetracarboxílico, 99 %, Thermo Scientific Chemicals
CAS: 89-32-7 Fórmula molecular: C10H2O6 Peso molecular (g/mol): 218.12 Número MDL: MFCD00005005 Clave InChI: ANSXAPJVJOKRDJ-UHFFFAOYSA-N Sinónimo: pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride PubChem CID: 6966 Nombre IUPAC: furo[3,4-f][2]benzofurano-1,3,5,7-tetrona SMILES: O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O
| Sinónimo | pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride |
|---|---|
| Clave InChI | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| PubChem CID | 6966 |
| Fórmula molecular | C10H2O6 |
| CAS | 89-32-7 |
| Peso molecular (g/mol) | 218.12 |
| Número MDL | MFCD00005005 |
| SMILES | O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O |
| Nombre IUPAC | furo[3,4-f][2]benzofurano-1,3,5,7-tetrona |
Anhídrido cis-1,2-ciclohexanodicarboxílico, 99 %, Thermo Scientific Chemicals
CAS: 13149-00-3 Fórmula molecular: C8H10O3 Peso molecular (g/mol): 154.17 Número MDL: MFCD00005926 Clave InChI: MUTGBJKUEZFXGO-OLQVQODUSA-N Sinónimo: cis-hexahydroisobenzofuran-1,3-dione,cis-1,2-cyclohexanedicarboxylic anhydride,cis-hexahydrophthalic anhydride,unii-b52z7tnv87,cis-cyclohexane-1,2-dicarboxylic anhydride,hexahydrophthalic anhydride, cis,3ar,7as-hexahydro-2-benzofuran-1,3-dione,1,3-isobenzofurandione, hexahydro-, 3ar,7as-rel,3ar,7as-hexahydroisobenzofuran-1,3-dione,1,3-isobenzofurandione, hexahydro-, cis PubChem CID: 641660 Nombre IUPAC: (3aS,7aR)-3a,4,5,6,7,7a-hexahidro-2-benzofuran-1,3-diona SMILES: C1CCC2C(C1)C(=O)OC2=O
| Sinónimo | cis-hexahydroisobenzofuran-1,3-dione,cis-1,2-cyclohexanedicarboxylic anhydride,cis-hexahydrophthalic anhydride,unii-b52z7tnv87,cis-cyclohexane-1,2-dicarboxylic anhydride,hexahydrophthalic anhydride, cis,3ar,7as-hexahydro-2-benzofuran-1,3-dione,1,3-isobenzofurandione, hexahydro-, 3ar,7as-rel,3ar,7as-hexahydroisobenzofuran-1,3-dione,1,3-isobenzofurandione, hexahydro-, cis |
|---|---|
| Clave InChI | MUTGBJKUEZFXGO-OLQVQODUSA-N |
| PubChem CID | 641660 |
| Fórmula molecular | C8H10O3 |
| CAS | 13149-00-3 |
| Peso molecular (g/mol) | 154.17 |
| Número MDL | MFCD00005926 |
| SMILES | C1CCC2C(C1)C(=O)OC2=O |
| Nombre IUPAC | (3aS,7aR)-3a,4,5,6,7,7a-hexahidro-2-benzofuran-1,3-diona |
4',5'-Dibromofluoresceína, Thermo Scientific™
CAS: 596-03-2 Fórmula molecular: C20H10Br2O5 Peso molecular (g/mol): 490.11 Clave InChI: ZDTNHRWWURISAA-UHFFFAOYSA-N Sinónimo: 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 PubChem CID: 11689 Nombre IUPAC: 4',5'-dibromo-3',6'-dihidroxiespiro[2-benzofuran-3,9'-xanteno]-1-ona SMILES: C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O
| Sinónimo | 4',5'-dibromofluorescein,solvent red 72,eosinic acid,japan orange 201,FD&C orange no. 5,c.i. solvent red 72,4',5'-dibromofluororescein,4,5-dibromofluorescein,d & c orange no. 5,japan orange no. 201 |
|---|---|
| Clave InChI | ZDTNHRWWURISAA-UHFFFAOYSA-N |
| PubChem CID | 11689 |
| Fórmula molecular | C20H10Br2O5 |
| CAS | 596-03-2 |
| Peso molecular (g/mol) | 490.11 |
| SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C(=C(C=C4)O)Br)OC5=C3C=CC(=C5Br)O |
| Nombre IUPAC | 4',5'-dibromo-3',6'-dihidroxiespiro[2-benzofuran-3,9'-xanteno]-1-ona |
Dianhídrido piromelítico, 98 %, Thermo Scientific Chemicals
CAS: 89-32-7 Fórmula molecular: C10H2O6 Peso molecular (g/mol): 218.12 Número MDL: MFCD00005005 Clave InChI: ANSXAPJVJOKRDJ-UHFFFAOYSA-N Sinónimo: pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride PubChem CID: 6966 SMILES: O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O
| Sinónimo | pyromellitic dianhydride,pyromellitic anhydride,pyromellitic acid anhydride,1,2,4,5-benzenetetracarboxylic anhydride,pyromellitic acid dianhydride,1h,3h-benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetrone,pmda,benzo 1,2-c:4,5-c' difuran-1,3,5,7-tetraone,unii-2z22t30qzq,1,2,4,5-benzenetetracarboxylic dianhydride |
|---|---|
| Clave InChI | ANSXAPJVJOKRDJ-UHFFFAOYSA-N |
| PubChem CID | 6966 |
| Fórmula molecular | C10H2O6 |
| CAS | 89-32-7 |
| Peso molecular (g/mol) | 218.12 |
| Número MDL | MFCD00005005 |
| SMILES | O=C1OC(=O)C2=CC3=C(C=C12)C(=O)OC3=O |