Resultados de la búsqueda filtrada
Amberlyst™ 15(H), húmeda, resina de intercambio iónico, Thermo Scientific Chemicals
CAS: 39389-20-3 Fórmula molecular: C18H18O3S Peso molecular (g/mol): 314.399 Número MDL: MFCD00145841 Clave InChI: SIWVGXQOXWGJCI-UHFFFAOYSA-N Sinónimo: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 Nombre IUPAC: 1,2-bis(etenil)benceno;ácido 2-etenilbencenosulfónico SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
|---|---|
| Clave InChI | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| PubChem CID | 170197 |
| Fórmula molecular | C18H18O3S |
| CAS | 39389-20-3 |
| Peso molecular (g/mol) | 314.399 |
| Número MDL | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Nombre IUPAC | 1,2-bis(etenil)benceno;ácido 2-etenilbencenosulfónico |
Thermo Scientific Chemicals Polvo de agar
CAS: 9002-18-0 Fórmula molecular: C14H24O9 Peso molecular (g/mol): 336.337 Número MDL: MFCD00081288 Clave InChI: GYYDPBCUIJTIBM-DYOGSRDZSA-N Sinónimo: agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol PubChem CID: 71571511 Nombre IUPAC: (2R,3S,4S,5R)-2-(hidroximetil)-6-[[(4R,5S)-4-hidroxi-3-metil-2,6-dioxabiciclo[3.2.1]octan-8-il]oxi]-4-metoxioxano-3,5-diol SMILES: CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | agar,agar, pure, powder,agar agar bacteriological,3r,4s,5s,6r-2-4r,5s-4-hydroxy-3-methyl-2,6-dioxabicyclo 3.2.1 octan-8-yl oxy-6-hydroxymethyl-4-methoxyoxane-3,5-diol |
|---|---|
| Clave InChI | GYYDPBCUIJTIBM-DYOGSRDZSA-N |
| PubChem CID | 71571511 |
| Fórmula molecular | C14H24O9 |
| CAS | 9002-18-0 |
| Peso molecular (g/mol) | 336.337 |
| Número MDL | MFCD00081288 |
| SMILES | CC1C(C2C(C(O1)CO2)OC3C(C(C(C(O3)CO)O)OC)O)O |
| Nombre IUPAC | (2R,3S,4S,5R)-2-(hidroximetil)-6-[[(4R,5S)-4-hidroxi-3-metil-2,6-dioxabiciclo[3.2.1]octan-8-il]oxi]-4-metoxioxano-3,5-diol |
Resina de intercambio iónico Amberlite IRA-402(CI), Thermo Scientific Chemicals
CAS: 52439-77-7 Número MDL: MFCD00145564
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| CAS | 52439-77-7 |
|---|---|
| Número MDL | MFCD00145564 |
AmberChrom™, 50WX8 200-400 (H)
CAS: 11119-67-8 Número MDL: MFCD00132726 Nombre IUPAC: AmberChrom™ 50WX8 Ion Exchange Resin
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| CAS | 11119-67-8 |
|---|---|
| Número MDL | MFCD00132726 |
| Nombre IUPAC | AmberChrom™ 50WX8 Ion Exchange Resin |
Resina de intercambio iónico Amberlite™ IRN-78, forma OH, Thermo Scientific Chemicals
CAS: 11128-95-3 Número MDL: MFCD00145822
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| CAS | 11128-95-3 |
|---|---|
| Número MDL | MFCD00145822 |
Partículas marrón pálido Amberlyst™ 15(H), Thermo Scientific Chemicals
CAS: 39389-20-3 Fórmula molecular: C18H18O3S Peso molecular (g/mol): 314.399 Número MDL: MFCD00145841 Clave InChI: SIWVGXQOXWGJCI-UHFFFAOYSA-N Sinónimo: amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid PubChem CID: 170197 Nombre IUPAC: 1,2-bis(etenil)benceno;ácido 2-etenilbencenosulfónico SMILES: C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Sinónimo | amberlyst 15, wet, ion exchange resin,2-ethenylbenzenesulfonic acid; divinylbenzene,benzenesulfonic acid, ethenyl-, polymer with diethenylbenzene,ksc581g2r,amberlyst 15 ion-exchange resin,amberlite? ir120 hydrogen form,2-ethenylbenzenesulfonic acid-1,2-diethenylbenzene 1:1,amberlite r ir120 hydrogen form,divinylbenzene-styrenesulfonic acid copolymer,1,2-bis ethenyl benzene; 2-ethenylbenzenesulfonic acid |
|---|---|
| Clave InChI | SIWVGXQOXWGJCI-UHFFFAOYSA-N |
| PubChem CID | 170197 |
| Fórmula molecular | C18H18O3S |
| CAS | 39389-20-3 |
| Peso molecular (g/mol) | 314.399 |
| Número MDL | MFCD00145841 |
| SMILES | C=CC1=CC=CC=C1C=C.C=CC1=CC=CC=C1S(=O)(=O)O |
| Nombre IUPAC | 1,2-bis(etenil)benceno;ácido 2-etenilbencenosulfónico |
Resina de intercambio iónico Amberlite™ IRA-67, Thermo Scientific Chemicals
CAS: 80747-90-6 Número MDL: MFCD00145567
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| CAS | 80747-90-6 |
|---|---|
| Número MDL | MFCD00145567 |
Resina de intercambio iónico (seca) Amberlyst™ 15, Thermo Scientific Chemicals
CAS: 9037-24-5 Fórmula molecular: MFCD00145841 Peso molecular (g/mol): 0.00 Número MDL: MFCD00145841 Clave InChI: YZUPZGFPHUVJKC-UHFFFAOYSA-N PubChem CID: 80972 SMILES: *
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Clave InChI | YZUPZGFPHUVJKC-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 80972 |
| Fórmula molecular | MFCD00145841 |
| CAS | 9037-24-5 |
| Peso molecular (g/mol) | 0.00 |
| Número MDL | MFCD00145841 |
| SMILES | * |
Resina de intercambio iónico Amberlite™ IRN-77, grado nuclear, Thermo Scientific Chemicals
CAS: 11128-94-2 Fórmula molecular: Styrene-DVB Número MDL: MFCD00145822
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| Fórmula molecular | Styrene-DVB |
|---|---|
| CAS | 11128-94-2 |
| Número MDL | MFCD00145822 |
Amberlite™ IRC-748, resina de intercambio iónico, Thermo Scientific Chemicals
CAS: 79620-28-3 Número MDL: MFCD00132702
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
| CAS | 79620-28-3 |
|---|---|
| Número MDL | MFCD00132702 |
Diaion™ HP20, resina adsorbente sintética, tipo altamente poroso, Thermo Scientific Chemicals
Separaciones de amino ácidos, moléculas pequeñas en hidrofobicidad media en disolventes polares
Pedido antes de las 2pm enviar hoy Pedido después de las 2pm enviar mañana
Más información
Amberlite™ IR-120(H), resina de intercambio iónico, Thermo Scientific Chemicals
CAS: 78922-04-0 Fórmula molecular: C13H10ClNO4S Peso molecular (g/mol): 311.736 Número MDL: MFCD00132707 Clave InChI: APBOVLPLJFJSRI-UHFFFAOYSA-N Sinónimo: 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid PubChem CID: 8190984 Nombre IUPAC: ácido 3-[(3-clorofenil)sulfonilamino]benzoico SMILES: C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O
| Sinónimo | 3-3-chlorophenylsulfonamido benzoic acid,3-3-chloro-benzenesulfonylamino-benzoic acid,3-3-chlorophenyl sulfonyl amino benzoic acid,benzoicacid, 3-3-chlorophenyl sulfonyl amino,3-3-chlorobenzenesulfonamido benzoic acid,amberlite ir-120,3-3-chlorophenyl sulfonylamino benzoic acid,3-3-chlorophenyl sulfonamido benzoic acid |
|---|---|
| Clave InChI | APBOVLPLJFJSRI-UHFFFAOYSA-N |
| PubChem CID | 8190984 |
| Fórmula molecular | C13H10ClNO4S |
| CAS | 78922-04-0 |
| Peso molecular (g/mol) | 311.736 |
| Número MDL | MFCD00132707 |
| SMILES | C1=CC(=CC(=C1)NS(=O)(=O)C2=CC(=CC=C2)Cl)C(=O)O |
| Nombre IUPAC | ácido 3-[(3-clorofenil)sulfonilamino]benzoico |
Dowex™ 1X8 100-200 (Cl), Thermo Scientific Chemicals
CAS: 12627-85-9 Fórmula molecular: C29H34ClN Peso molecular (g/mol): 432.05 Número MDL: MFCD00132718 Clave InChI: BBQMUEOYPPPODD-UHFFFAOYSA-M Sinónimo: dowex 1x2 50-100 cl,dowex 1x8 50-100 cl PubChem CID: 16212807 Nombre IUPAC: 1,4-bis(etenil)benceno;(4-etenilfenil)-trimetilazanio;estireno;cloruro SMILES: *
| Sinónimo | dowex 1x2 50-100 cl,dowex 1x8 50-100 cl |
|---|---|
| Clave InChI | BBQMUEOYPPPODD-UHFFFAOYSA-M |
| PubChem CID | 16212807 |
| Fórmula molecular | C29H34ClN |
| CAS | 12627-85-9 |
| Peso molecular (g/mol) | 432.05 |
| Número MDL | MFCD00132718 |
| SMILES | * |
| Nombre IUPAC | 1,4-bis(etenil)benceno;(4-etenilfenil)-trimetilazanio;estireno;cloruro |
Amberlite™ IRA-900(Cl), resina de intercambio iónico, Thermo Scientific Chemicals
CAS: 9050-97-9 Fórmula molecular: C4H12ClN Peso molecular (g/mol): 109.60 Número MDL: MFCD00132712 Clave InChI: OKIZCWYLBDKLSU-UHFFFAOYSA-M Sinónimo: tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl PubChem CID: 6379 ChEBI: CHEBI:7070 Nombre IUPAC: tetrametilazanio; cloruro SMILES: [Cl-].C[N+](C)(C)C
| Sinónimo | tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl |
|---|---|
| Clave InChI | OKIZCWYLBDKLSU-UHFFFAOYSA-M |
| PubChem CID | 6379 |
| Fórmula molecular | C4H12ClN |
| CAS | 9050-97-9 |
| ChEBI | CHEBI:7070 |
| Peso molecular (g/mol) | 109.60 |
| Número MDL | MFCD00132712 |
| SMILES | [Cl-].C[N+](C)(C)C |
| Nombre IUPAC | tetrametilazanio; cloruro |
| CAS | 104219-63-8 |
|---|---|
| Número MDL | MFCD00145831 |