missing translation for 'onlineSavingsMsg'
Learn More
Learn More
4-Fenoxibenzaldehído, 98 %, Thermo Scientific Chemicals
66.70€ - 223.00€
Identificadores de productos químicos
| CAS | 67-36-7 |
|---|---|
| Fórmula molecular | C13H10O2 |
| Peso molecular (g/mol) | 198.22 |
| Número MDL | MFCD00003383 |
| Clave InChI | QWLHJVDRPZNVBS-UHFFFAOYSA-N |
| Sinónimo | p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde |
| PubChem CID | 66139 |
| Nombre IUPAC | 4-fenoxibenzaldehído |
| SMILES | O=CC1=CC=C(OC2=CC=CC=C2)C=C1 |
| Código de producto | Marca | Cantidad | Envase | Precio | Cantidad y disponibilidad | ||||
|---|---|---|---|---|---|---|---|---|---|
| Código de producto | Marca | Cantidad | Envase | Precio | Cantidad y disponibilidad | ||||
|
10032490
|
Thermo Scientific Acros
198930050 |
5 g | Frasco de vidrio |
66.70€
5 g |
Por favor, inicie sesión para comprar este producto. ¿No tiene usuario web? Regístrese hoy mismo. | ||||
|
10338290
|
Thermo Scientific
198930250 |
25 g | Frasco de vidrio |
223.00€
25 g |
Por favor, inicie sesión para comprar este producto. ¿No tiene usuario web? Regístrese hoy mismo. | ||||
Descripción
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificadores de productos químicos
| 67-36-7 | |
| 198.22 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 66139 | |
| O=CC1=CC=C(OC2=CC=CC=C2)C=C1 |
| C13H10O2 | |
| MFCD00003383 | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| 4-fenoxibenzaldehído |
Especificaciones
| 4-Phenoxybenzaldehyde | |
| 67-36-7 | |
| 100.0 | |
| De incoloro a amarillo | |
| 185°C (14.0 mmHg) | |
| Auténtico | |
| C13H10O2 | |
| 1.6100 to 1.612 | |
| 1.132 | |
| QWLHJVDRPZNVBS-UHFFFAOYSA-N | |
| 4-fenoxibenzaldehído | |
| 66139 | |
| 98% |
| 98% | |
| 97.5 | |
| 24°C to 25°C | |
| 1.1320g/mL | |
| >112°C | |
| 97.5% min. (GC) | |
| C6H5OC6H4CHO | |
| MFCD00003383 | |
| p-phenoxybenzaldehyde, 4-formyldiphenyl ether, benzaldehyde, p-phenoxy, benzaldehyde, 4-phenoxy, 4-phenoxy-benzaldehyde, 4-phenyloxy benzaldehyde, diphenyl ether 4-carboxaldehyde, zlchem 548, 4-formyldiphenylether, 4-phenoxy benzaldehyde | |
| O=CC1=CC=C(OC2=CC=CC=C2)C=C1 | |
| 198.22 | |
| 198.22 | |
| Líquido después derretirse |
Safety and Handling
missing translation for 'einecsNumber' : 200-650-7
missing translation for 'rtecsNumber' : CU7560000.
RUO – Research Use Only