Dihidrofuranos
- (3)
- (3)
- (5)
- (6)
- (6)
- (6)
- (2)
- (3)
- (2)
- (2)
- (1)
- (3)
- (2)
- (10)
- (1)
- (1)
- (7)
- (1)
- (5)
- (2)
- (7)
- (1)
- (2)
- (1)
- (1)
- (2)
- (4)
- (2)
- (2)
- (1)
- (1)
- (6)
- (1)
- (1)
- (3)
- (3)
- (1)
- (3)
- (10)
- (1)
- (4)
- (2)
- (5)
- (4)
- (1)
- (1)
- (5)
- (2)
- (6)
Resultados de la búsqueda filtrada
2,3-Dihidrofurano, +98 %, Thermo Scientific Chemicals
CAS: 1191-99-7 Fórmula molecular: C4H6O Peso molecular (g/mol): 70.09 Número MDL: MFCD00003205 Clave InChI: JKTCBAGSMQIFNL-UHFFFAOYSA-N PubChem CID: 70934 ChEBI: CHEBI:51662 Nombre IUPAC: 2,3-dihidrofurano SMILES: C1CC=CO1
| Clave InChI | JKTCBAGSMQIFNL-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 70934 |
| Fórmula molecular | C4H6O |
| CAS | 1191-99-7 |
| ChEBI | CHEBI:51662 |
| Peso molecular (g/mol) | 70.09 |
| Número MDL | MFCD00003205 |
| SMILES | C1CC=CO1 |
| Nombre IUPAC | 2,3-dihidrofurano |
2,3-Dihidrofurano, +98 %, Thermo Scientific Chemicals
CAS: 1191-99-7 Fórmula molecular: C4H6O Peso molecular (g/mol): 70.09 Número MDL: MFCD00003205 Clave InChI: JKTCBAGSMQIFNL-UHFFFAOYSA-N PubChem CID: 70934 ChEBI: CHEBI:51662 Nombre IUPAC: 2,3-dihidrofurano SMILES: C1CC=CO1
| Clave InChI | JKTCBAGSMQIFNL-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 70934 |
| Fórmula molecular | C4H6O |
| CAS | 1191-99-7 |
| ChEBI | CHEBI:51662 |
| Peso molecular (g/mol) | 70.09 |
| Número MDL | MFCD00003205 |
| SMILES | C1CC=CO1 |
| Nombre IUPAC | 2,3-dihidrofurano |
2,5-Dihidrofurano, 98 %, Thermo Scientific Chemicals
CAS: 1708-29-8 Fórmula molecular: C4H6O Peso molecular (g/mol): 70.09 Clave InChI: ARGCQEVBJHPOGB-UHFFFAOYSA-N Sinónimo: furan, 2,5-dihydro,3-oxolene,1-oxa-3-cyclopentene,2,5-dihydro-furan,furan,5-dihydro,oxa-3-cyclopentene,2,5 dihydrofurane,2,5-dihydro-fura,pubchem3987,acmc-1buc6 PubChem CID: 15570 Nombre IUPAC: 2,5-dihidrofurano SMILES: C1C=CCO1
| Sinónimo | furan, 2,5-dihydro,3-oxolene,1-oxa-3-cyclopentene,2,5-dihydro-furan,furan,5-dihydro,oxa-3-cyclopentene,2,5 dihydrofurane,2,5-dihydro-fura,pubchem3987,acmc-1buc6 |
|---|---|
| Clave InChI | ARGCQEVBJHPOGB-UHFFFAOYSA-N |
| PubChem CID | 15570 |
| Fórmula molecular | C4H6O |
| CAS | 1708-29-8 |
| Peso molecular (g/mol) | 70.09 |
| SMILES | C1C=CCO1 |
| Nombre IUPAC | 2,5-dihidrofurano |
2,5-Dihidro-2,5-dimetoxifurano, cis + trans, 99 %, Thermo Scientific Chemicals
CAS: 332-77-4 Fórmula molecular: C6H10O3 Peso molecular (g/mol): 130.14 Número MDL: MFCD00003220 Clave InChI: WXFWXFIWDGJRSC-UHFFFAOYNA-N Sinónimo: 2,5-dihydro-2,5-dimethoxyfuran,furan, 2,5-dihydro-2,5-dimethoxy,2,5-dihydro-2,5-dimethoxyfuran, cis+trans,2,5-dihydro-2,5-dimethoxyfuran, mixture of cis and trans,pubchem6933,ksc490q3d,furan,5-dihydro-2,5-dimethoxy,2,5-dihydro-2,5-dimethoxyfuran,c&t,2,5-dimethoxy-2,5-dihydrofuran,c&t,2,5-dihydro-2,5-dimethoxyfuran, cis + trans PubChem CID: 78974 Nombre IUPAC: 2,5-dimetoxi-2,5-dihidrofurano SMILES: COC1OC(OC)C=C1
| Sinónimo | 2,5-dihydro-2,5-dimethoxyfuran,furan, 2,5-dihydro-2,5-dimethoxy,2,5-dihydro-2,5-dimethoxyfuran, cis+trans,2,5-dihydro-2,5-dimethoxyfuran, mixture of cis and trans,pubchem6933,ksc490q3d,furan,5-dihydro-2,5-dimethoxy,2,5-dihydro-2,5-dimethoxyfuran,c&t,2,5-dimethoxy-2,5-dihydrofuran,c&t,2,5-dihydro-2,5-dimethoxyfuran, cis + trans |
|---|---|
| Clave InChI | WXFWXFIWDGJRSC-UHFFFAOYNA-N |
| PubChem CID | 78974 |
| Fórmula molecular | C6H10O3 |
| CAS | 332-77-4 |
| Peso molecular (g/mol) | 130.14 |
| Número MDL | MFCD00003220 |
| SMILES | COC1OC(OC)C=C1 |
| Nombre IUPAC | 2,5-dimetoxi-2,5-dihidrofurano |
3'-Deoxi-2',3'-didehidrotimidina, 98 %, Thermo Scientific Chemicals
CAS: 3056-17-5 Fórmula molecular: C10H12N2O4 Peso molecular (g/mol): 224.22 Número MDL: MFCD00132921 Clave InChI: XNKLLVCARDGLGL-HGXVMFPFNA-N Sinónimo: stavudine,sanilvudine,zerit,2',3'-didehydro-3'-deoxythymidine,estavudina,stavudinum,zerit xr,zerut xr,stavudinum inn-latin,2',3'-anhydrothymidine PubChem CID: 18283 ChEBI: CHEBI:63581 Nombre IUPAC: 1-[(2R,5S)-5-(hidroximetil)-2,5-dihidrofurano-2-il]-5-metilpirimidina-2,4-diona SMILES: CC1=CN([C@@H]2O[C@H](CO)C=C2)C(=O)NC1=O
| Sinónimo | stavudine,sanilvudine,zerit,2',3'-didehydro-3'-deoxythymidine,estavudina,stavudinum,zerit xr,zerut xr,stavudinum inn-latin,2',3'-anhydrothymidine |
|---|---|
| Clave InChI | XNKLLVCARDGLGL-HGXVMFPFNA-N |
| PubChem CID | 18283 |
| Fórmula molecular | C10H12N2O4 |
| CAS | 3056-17-5 |
| ChEBI | CHEBI:63581 |
| Peso molecular (g/mol) | 224.22 |
| Número MDL | MFCD00132921 |
| SMILES | CC1=CN([C@@H]2O[C@H](CO)C=C2)C(=O)NC1=O |
| Nombre IUPAC | 1-[(2R,5S)-5-(hidroximetil)-2,5-dihidrofurano-2-il]-5-metilpirimidina-2,4-diona |
2,3-Dihidrofurano, TRC
CAS: 1191-99-7 Fórmula molecular: C4H6O Peso molecular (g/mol): 70.09 Sinónimo: 4,5-Dihydrofuran,NSC 85221 SMILES: C1CC=CO1
| Sinónimo | 4,5-Dihydrofuran,NSC 85221 |
|---|---|
| Fórmula molecular | C4H6O |
| CAS | 1191-99-7 |
| Peso molecular (g/mol) | 70.09 |
| SMILES | C1CC=CO1 |
Ácido 3-O-Etil-L-ascórbico, TRC
CAS: 86404-04-8 Fórmula molecular: C8H12O6 Peso molecular (g/mol): 204.18 SMILES: CCOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO
| Fórmula molecular | C8H12O6 |
|---|---|
| CAS | 86404-04-8 |
| Peso molecular (g/mol) | 204.18 |
| SMILES | CCOC1=C(O)C(=O)O[C@@H]1[C@@H](O)CO |
5-Etil-3-hidroxi-4-metil-2(5H)-furanona, TRC
CAS: 698-10-2 Fórmula molecular: C7H10O3 Peso molecular (g/mol): 142.15 Sinónimo: 2,4-Dihydroxy-3-methyl-2-hexenoic Acid γ-Lactone,3-Hydroxy-4-methyl-5-ethyl-2(5H)-furanone,Abhexone,Homosotolone,α-Hydroxy-β-methyl-δα,β-γ-hexenolactone,α-Hydroxy-β-methyl-γ-hexenolactone SMILES: O=C1C(O)=C(C)C(CC)O1
| Sinónimo | 2,4-Dihydroxy-3-methyl-2-hexenoic Acid γ-Lactone,3-Hydroxy-4-methyl-5-ethyl-2(5H)-furanone,Abhexone,Homosotolone,α-Hydroxy-β-methyl-δα,β-γ-hexenolactone,α-Hydroxy-β-methyl-γ-hexenolactone |
|---|---|
| Fórmula molecular | C7H10O3 |
| CAS | 698-10-2 |
| Peso molecular (g/mol) | 142.15 |
| SMILES | O=C1C(O)=C(C)C(CC)O1 |
3-Cloro-4-(diclorometil)-5-hidroxi-2(5H)-furanona, TRC
CAS: 77439-76-0 Fórmula molecular: C5 H3 Cl3 O3 Peso molecular (g/mol): 217.43 Sinónimo: MX,MX (Bacterial Mutagen),Mutagen X; Nombre IUPAC: 4-cloro-3-(diclorometil)-2-hidroxi-2H-furano-5-uno SMILES: OC1OC(=O)C(=C1C(Cl)Cl)Cl
| Sinónimo | MX,MX (Bacterial Mutagen),Mutagen X; |
|---|---|
| Fórmula molecular | C5 H3 Cl3 O3 |
| CAS | 77439-76-0 |
| Peso molecular (g/mol) | 217.43 |
| SMILES | OC1OC(=O)C(=C1C(Cl)Cl)Cl |
| Nombre IUPAC | 4-cloro-3-(diclorometil)-2-hidroxi-2H-furano-5-uno |
L-treo-Hex-2-ácido 1,4-lactona 6-Éster Metílico, TRC
CAS: 122046-79-1 Fórmula molecular: C7 H8 O7 Peso molecular (g/mol): 204.13 Sinónimo: L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester (9CI),Methyl (R)-[(2R)-3,4-Dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]hydroxyacetate Nombre IUPAC: metil(2R)-2-[(2R)-3,4-dihidroxi-5-oxo-2H-furano-2-il]-2-hidroxiacetato SMILES: COC(=O)[C@H](O)[C@H]1OC(=O)C(=C1O)O
| Sinónimo | L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester (9CI),Methyl (R)-[(2R)-3,4-Dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]hydroxyacetate |
|---|---|
| Fórmula molecular | C7 H8 O7 |
| CAS | 122046-79-1 |
| Peso molecular (g/mol) | 204.13 |
| SMILES | COC(=O)[C@H](O)[C@H]1OC(=O)C(=C1O)O |
| Nombre IUPAC | metil(2R)-2-[(2R)-3,4-dihidroxi-5-oxo-2H-furano-2-il]-2-hidroxiacetato |
2-Fosfo-L-ácido ascórbico Sal Trisódica, TRC
CAS: 66170-10-3 Fórmula molecular: C6H6Na3O9P Peso molecular (g/mol): 322.05 Sinónimo: Ascorbic Acid Phosphate Sodium Salt,L-Ascorbic Acid 2-(Dihydrogen Phosphate) Trisodium Salt,Sodium Ascorbyl Phosphate,Stay-C 50,Trisodium Ascorbate-2-phosphate,VCP-NA Nombre IUPAC: trisodio; [(2R)-2-[(1S)-1,2-dihidroxietil]-3-óxido-5-oxo-2H-furano-4-il] fosfato SMILES: [Na+].[Na+].[Na+].OC[C@H](O)[C@H]1OC(=O)C(=C1[O-])OP(=O)([O-])[O-]
| Sinónimo | Ascorbic Acid Phosphate Sodium Salt,L-Ascorbic Acid 2-(Dihydrogen Phosphate) Trisodium Salt,Sodium Ascorbyl Phosphate,Stay-C 50,Trisodium Ascorbate-2-phosphate,VCP-NA |
|---|---|
| Fórmula molecular | C6H6Na3O9P |
| CAS | 66170-10-3 |
| Peso molecular (g/mol) | 322.05 |
| SMILES | [Na+].[Na+].[Na+].OC[C@H](O)[C@H]1OC(=O)C(=C1[O-])OP(=O)([O-])[O-] |
| Nombre IUPAC | trisodio; [(2R)-2-[(1S)-1,2-dihidroxietil]-3-óxido-5-oxo-2H-furano-4-il] fosfato |
Ácido D(-)-isoascórbico (ácido eritórbico), TRC
CAS: 89-65-6 Fórmula molecular: C6 H8 O6 Peso molecular (g/mol): 176.12 Sinónimo: D-erythro-Hex-2-enonic acid, γ-lactone,D-erythro-Hexonic acid, 3-keto-, γ-lactone (6CI),Erythorbic acid (7CI),Araboascorbic acid,Araboascorbic acid, D-,D-(-)-Isoascorbic acid,D-Araboascorbic acid,D-Erythorbic acid,D-Isoascorbic acid,D-arabino-Ascorbic acid,E 315,Erycorbin,Glucosaccharonic acid,Isoascorbic acid,Isovitamin C,Mercate 5,NSC 8117,Neo-Cebicure,Saccharosonic acid,D-Isoascorbic Acid,(5R)-5-[(1R)-1,2-Dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one,Ascorbic Acid Imp. F (EP) Nombre IUPAC: (2R)-2-[(1R)-1,2-dihidroxietil]-3,4-dihidroxi-2H-furan-5-ona SMILES: OC[C@@H](O)[C@H]1OC(=O)C(=C1O)O
| Sinónimo | D-erythro-Hex-2-enonic acid, γ-lactone,D-erythro-Hexonic acid, 3-keto-, γ-lactone (6CI),Erythorbic acid (7CI),Araboascorbic acid,Araboascorbic acid, D-,D-(-)-Isoascorbic acid,D-Araboascorbic acid,D-Erythorbic acid,D-Isoascorbic acid,D-arabino-Ascorbic acid,E 315,Erycorbin,Glucosaccharonic acid,Isoascorbic acid,Isovitamin C,Mercate 5,NSC 8117,Neo-Cebicure,Saccharosonic acid,D-Isoascorbic Acid,(5R)-5-[(1R)-1,2-Dihydroxyethyl]-3,4-dihydroxyfuran-2(5H)-one,Ascorbic Acid Imp. F (EP) |
|---|---|
| Fórmula molecular | C6 H8 O6 |
| CAS | 89-65-6 |
| Peso molecular (g/mol) | 176.12 |
| SMILES | OC[C@@H](O)[C@H]1OC(=O)C(=C1O)O |
| Nombre IUPAC | (2R)-2-[(1R)-1,2-dihidroxietil]-3,4-dihidroxi-2H-furan-5-ona |