missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Éster de pinacol de ácido 4-(etoxicarbonil)bencenoborónico, 97 %, Thermo Scientific™
34.76€ - 368.00€
Identificadores de productos químicos
| CAS | 195062-62-5 |
|---|---|
| Fórmula molecular | C15H21BO4 |
| Peso molecular (g/mol) | 276.139 |
| Número MDL | MFCD03453659 |
| Clave InChI | NCVIYKCFTYSAGN-UHFFFAOYSA-N |
| Sinónimo | ethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonylphenylboronic acid pinacol ester, 4-ethoxycarbonylphenylboronic acid, pinacol ester, 4-carboethoxyphenylboronic acid pinacol ester, ethyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, ethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonyl benzeneboronic acid pinacol ester, 2-4-ethoxycarbonyl phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid ethyl ester |
| PubChem CID | 2734618 |
| Nombre IUPAC | 4-(4,4,5,5-tetrametil-1,3,2-dioxaborolan-2-il)benzoato de etilo |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OCC |
Descripción
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identificadores de productos químicos
| 195062-62-5 | |
| 276.139 | |
| NCVIYKCFTYSAGN-UHFFFAOYSA-N | |
| 2734618 | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OCC |
| C15H21BO4 | |
| MFCD03453659 | |
| ethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonylphenylboronic acid pinacol ester, 4-ethoxycarbonylphenylboronic acid, pinacol ester, 4-carboethoxyphenylboronic acid pinacol ester, ethyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, ethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonyl benzeneboronic acid pinacol ester, 2-4-ethoxycarbonyl phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid ethyl ester | |
| 4-(4,4,5,5-tetrametil-1,3,2-dioxaborolan-2-il)benzoato de etilo |
Especificaciones
| 4-(Ethoxycarbonyl)benzeneboronic acid pinacol ester | |
| Incolora | |
| 330°C | |
| 1.5000 | |
| ethyl 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonylphenylboronic acid pinacol ester, 4-ethoxycarbonylphenylboronic acid, pinacol ester, 4-carboethoxyphenylboronic acid pinacol ester, ethyl 4-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, ethyl-4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoate, 4-ethoxycarbonyl benzeneboronic acid pinacol ester, 2-4-ethoxycarbonyl phenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4-4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl benzoic acid ethyl ester | |
| B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)OCC | |
| 276.139 | |
| 276.14 | |
| Líquido |
| 195062-62-5 | |
| 1.052g/mL | |
| C15H21BO4 | |
| MFCD03453659 | |
| NCVIYKCFTYSAGN-UHFFFAOYSA-N | |
| 4-(4,4,5,5-tetrametil-1,3,2-dioxaborolan-2-il)benzoato de etilo | |
| 2734618 | |
| 97% |