Difenilacetonitrilos
- (2)
- (2)
- (4)
- (3)
- (3)
- (3)
- (3)
- (1)
- (1)
- (1)
- (3)
- (1)
- (1)
- (1)
- (2)
- (1)
- (2)
- (1)
- (1)
- (3)
- (1)
- (3)
- (3)
- (3)
- (2)
- (4)
- (3)
- (2)
- (4)
- (4)
Resultados de la búsqueda filtrada
Difenilacetronitrilo, +99 %, Thermo Scientific Chemicals
CAS: 86-29-3 Fórmula molecular: C14H11N Peso molecular (g/mol): 193.25 Clave InChI: NEBPTMCRLHKPOB-UHFFFAOYSA-N Sinónimo: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 Nombre IUPAC: 2,2-difenilacetonitrilo SMILES: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| Sinónimo | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
|---|---|
| Clave InChI | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| PubChem CID | 6837 |
| Fórmula molecular | C14H11N |
| CAS | 86-29-3 |
| Peso molecular (g/mol) | 193.25 |
| SMILES | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| Nombre IUPAC | 2,2-difenilacetonitrilo |
2,2-Difenilpropionitrilo, 97 %, Thermo Scientific Chemicals
CAS: 5558-67-8 Fórmula molecular: C15H13N Peso molecular (g/mol): 207.276 Número MDL: MFCD00001846 Clave InChI: DPVHBXFSKLKYIQ-UHFFFAOYSA-N PubChem CID: 79677 Nombre IUPAC: 2,2-difenilpropanenitrilo SMILES: CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2
| Clave InChI | DPVHBXFSKLKYIQ-UHFFFAOYSA-N |
|---|---|
| PubChem CID | 79677 |
| Fórmula molecular | C15H13N |
| CAS | 5558-67-8 |
| Peso molecular (g/mol) | 207.276 |
| Número MDL | MFCD00001846 |
| SMILES | CC(C#N)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Nombre IUPAC | 2,2-difenilpropanenitrilo |
Difenilacetonitrilo, 99 %, Thermo Scientific Chemicals
CAS: 86-29-3 Fórmula molecular: C14H11N Peso molecular (g/mol): 193.249 Número MDL: MFCD00001862 Clave InChI: NEBPTMCRLHKPOB-UHFFFAOYSA-N Sinónimo: diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril PubChem CID: 6837 Nombre IUPAC: 2,2-difenilacetonitrilo SMILES: C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2
| Sinónimo | diphenylacetonitrile,dipan,diphenatrile,benzhydrylcyanide,diphenylmethylcyanide,benzyhydrylcyanide,acetonitrile, diphenyl,benzeneacetonitrile, alpha-phenyl,usaf kf-13,difenylacetonitril |
|---|---|
| Clave InChI | NEBPTMCRLHKPOB-UHFFFAOYSA-N |
| PubChem CID | 6837 |
| Fórmula molecular | C14H11N |
| CAS | 86-29-3 |
| Peso molecular (g/mol) | 193.249 |
| Número MDL | MFCD00001862 |
| SMILES | C1=CC=C(C=C1)C(C#N)C2=CC=CC=C2 |
| Nombre IUPAC | 2,2-difenilacetonitrilo |
4-Bromo-2,2-difenilbutironitrilo 95, %, Thermo Scientific Chemicals
CAS: 39186-58-8 Fórmula molecular: C16H14BrN Peso molecular (g/mol): 300.199 Número MDL: MFCD00001845 Clave InChI: IGYSFJHVFHNOEI-UHFFFAOYSA-N Sinónimo: 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile PubChem CID: 96575 Nombre IUPAC: 4-bromo-2,2-difenilbutanenitrilo SMILES: C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2
| Sinónimo | 4-bromo-2,2-diphenylbutyronitrile,2,2-diphenyl-4-bromobutyronitrile,4-bromo-2,2-diphenyl-butyronitrile,3-cyano-3,3-diphenylpropyl bromide,benzeneacetonitrile, .alpha.-2-bromoethyl-.alpha.-phenyl,acmc-1csza,butyronitrile,2-diphenyl,ksc495i2r,aronis25014,bromoethyl diphenyl acetonitrile |
|---|---|
| Clave InChI | IGYSFJHVFHNOEI-UHFFFAOYSA-N |
| PubChem CID | 96575 |
| Fórmula molecular | C16H14BrN |
| CAS | 39186-58-8 |
| Peso molecular (g/mol) | 300.199 |
| Número MDL | MFCD00001845 |
| SMILES | C1=CC=C(C=C1)C(CCBr)(C#N)C2=CC=CC=C2 |
| Nombre IUPAC | 4-bromo-2,2-difenilbutanenitrilo |
Methyl-Alpha,Alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture), TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.
| Fórmula molecular | C21H24N2O |
|---|---|
| Fórmula InChI | InChI=1S/2C21H24N2O/c1-18(16-23-12-14-24-15-13-23)21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20;1-18(23-12-14-24-15-13-23)16-21(17-22,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2*2-11,18H,12-16H2,1H3 |
| Nombre del producto químico o material | Methyl-alpha,alpha-diphenyl-4-morpholinebutyronitrile(Regioisomer Mixture) |
| Almacenamiento recomendado | +4°C |
| Peso molecular (g/mol) | 320.43 |
| SMILES | CC(C(C1=CC=CC=C1)(C2=CC=CC=C2)C#N)CN3CCOCC3.CC(CC(C4=CC=CC=C4)(C5=CC=CC=C5)C#N)N6CCOCC6 |
| Formula Weight (peso de la fórmula) | 320.19 |
Closantel, TRC
CAS: 57808-65-8 Fórmula molecular: C22 H14 Cl2 I2 N2 O2 Peso molecular (g/mol): 663.07 Sinónimo: N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz Nombre IUPAC: N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide SMILES: Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O
| Sinónimo | N-[5-chloro-4-[(4-chlorophenyl)cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide,Closantel,Clozantin,NSC 335306,Seponver,Zycloz |
|---|---|
| Fórmula molecular | C22 H14 Cl2 I2 N2 O2 |
| CAS | 57808-65-8 |
| Peso molecular (g/mol) | 663.07 |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c3cc(I)cc(I)c3O |
| Nombre IUPAC | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
Diphenylacetonitrile, TRC
CAS: 86-29-3 Fórmula molecular: C14 H11 N Peso molecular (g/mol): 193.24 Sinónimo: Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) Nombre IUPAC: 2,2-diphenylacetonitrile SMILES: N#CC(c1ccccc1)c2ccccc2
| Sinónimo | Diphenylacetonitrile,Methadone Hydrochoride Imp. E (EP) |
|---|---|
| Fórmula molecular | C14 H11 N |
| CAS | 86-29-3 |
| Peso molecular (g/mol) | 193.24 |
| SMILES | N#CC(c1ccccc1)c2ccccc2 |
| Nombre IUPAC | 2,2-diphenylacetonitrile |