CAS RN 36051-31-7
Sal disódica de guanosina-5'-trifosfato, ≥ 95%, MP Biomedicals™
CAS: 36051-31-7 Fórmula molecular: C10H16MgN5O14P3 Peso molecular (g/mol): 547.49 Número MDL: MFCD03410297 Clave InChI: NMQPZZLDIUETGE-GWTDSMLYSA-N Sinónimo: guanosine 5'-triphosphate,guanosine-5'-triphosphate disodium salt dihydrate gtp,guanosine-triphosphate,guanosine 5'-triphosphate 4-,gtp 4-,2r,3s,4r,5r-5-2-amino-6-hydroxy-9h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methyl phosphonato oxy phosphonatooxy phosphinate,2r,3s,4r,5r-5-2-amino-6-oxo-3h-purin-9-yl-3,4-dihydroxyoxolan-2-yl methoxy-oxidophosphoryl oxy-oxidophosphoryl phosphate PubChem CID: 131676145 SMILES: [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Sal trisódica de guanosina-5'-trifosfato, 98-100 %, MP Biomedicals™
CAS: 36051-31-7 Fórmula molecular: C10H16MgN5O14P3 Peso molecular (g/mol): 547.49 Número MDL: MFCD00077781,MFCD00077781 Clave InChI: NMQPZZLDIUETGE-GWTDSMLYSA-N Sinónimo: 5'-gtp trisodium salt,5 acute-gtp trisodium salt PubChem CID: 92044363 SMILES: [Mg].NC1=NC(=O)C2=C(N1)N(C=N2)[C@@H]1O[C@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)[C@@H](O)[C@H]1O
Sal trisódica de guanosina-5'-trifosfato, TRC
Moléculas orgánicas de alta pureza y estándares analíticos, entregados estratégicamente en todo el mundo para potenciar la innovación y el éxito comercial.
Guanosina-5'-trifosfato Sal Trisódica (grado técnico), TRC
CAS: 36051-31-7 Fórmula molecular: C10H13N5Na3O14P3 Peso molecular (g/mol): 588.94 Sinónimo: Guanosine 5'-(tetrahydrogen Triphosphate), Trisodium Salt,Guanosine 5'-(tetrahydrogen Triphosphate), Trisodium Salt,5'-GTP Di-Na Salt,Trisodium 5'-GTP,GTP Trisodium Salt Nombre IUPAC: trisodio; (2R,3S,4R,5R)-5-(2-amino-6-oxo-1H-purina-9-il)-3,4-dihidroxioxilano-2-il]metoxi-oxidofosforilo]oxi-oxidofosforilo] fosfato de hidrógeno SMILES: [Na+].[Na+].[Na+].NC1=Nc2c(ncn2[C@@H]3O[C@H](COP(=O)([O-])OP(=O)([O-])OP(=O)(O)[O-])[C@@H](O)[C@H]3O)C(=O)N1
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.
MedChemExpress Guanosine 5'-triphosphate trisodium salt
MedChemExpress Guanosine 5'-triphosphate trisodium salt (5'-GTP trisodium salt) is an activator of the signal transducing G proteins which are involved in various cellular processes including proliferation, differentiation, and activation of several intracellular kinase cascades.