CAS RN 103404-75-7
CAS RN 103404-75-7
Thermo Scientific Acros D-luciferina sal sódica monohidrato, +98 %, Thermo Scientific Chemicals
CAS: 103404-75-7 Fórmula molecular: C11H7N2NaO3S2 Peso molecular (g/mol): 302.298 Número MDL: MFCD11865368 Clave InChI: BZNVUYVALNTPBG-QWLWRJJTSA-M Sinónimo: Firefly Luciferin monosodium salt monohydrate PubChem CID: 133109097 Nombre IUPAC: sodio; (2E,4R)-2-(6-oxo-1,3-benzotiazol-2-ilideno)-1,3-tiazolidina-4-carboxilato SMILES: C1C(NC(=C2N=C3C=CC(=O)C=C3S2)S1)C(=O)[O-].[Na+]
MedChemExpress D-Luciferin sodium
MedChemExpress D-Luciferin (D-(-)-Luciferin) sodium is the substrate of luciferases that catalyze the production of light in bioluminescent insects.

MedChemExpress D-Luciferin sodium
MedChemExpress D-Luciferin (D-(-)-Luciferin) sodium is the substrate of luciferases that catalyze the production of light in bioluminescent insects.
