CAS RN 1143-70-0
Urolitina A, TRC
CAS: 1143-70-0 Fórmula molecular: C13 H8 O4 Peso molecular (g/mol): 228.2 Sinónimo: 6H-Dibenzo[b,d]pyran-6-one, 3,8-dihydroxy- (9CI, ACI),2-Biphenylcarboxylic acid, 2',4,4'-trihydroxy-, δ-lactone (7CI, 8CI),3,8-Dihydroxy-6H-dibenzo[b,d]pyran-6-one (ACI),2',7-Dihydroxy-3,4-benzocoumarin,3,8-Dihydroxybenzo[c]chromen-6-one,3,8-Dihydroxyurolithin,3,8-Hydroxydibenzo-α-pyrone,Urolithin A Nombre IUPAC: 3,8-dihidroxibenzo[c]cromo-6-uno SMILES: Oc1ccc2c(OC(=O)c3cc(O)ccc23)c1
Tocris Bioscience™ Urolithin A
PI 3-K/Akt/mTOR signaling pathway inhibitor; blocks phosphorylation of Akt and p70S6K in pancreatic ductal adenocarcinoma (PDAC)
Urolithin A, MedChemExpress
MedChemExpress Urolithin A, a gut-microbial metabolite of ellagic acid, exerts anti-inflammatory, antiproliferative, and antioxidant properties. Urolithin A induces autophagy and apoptosis, suppresses cell cycle progression, and inhibits DNA synthesis.