man

Test

CAS RN 1078166-57-0

H3COONOFOHO

CAS RN 1078166-57-0

IUPAC Name: 1-(4-fluorobenzoyl)-3-{[(6-methoxynaphthalen-2-yl)oxy]methyl}azetidine-3-carboxylic acid
Sinónimos: 1-(4-fluorobenzoyl)-3-{[(6-methoxynaphthalen-2-yl)oxy]methyl}azetidine-3-carboxylic acid
Peso molecular (g/mol): 409.41
Fórmula molecular: C23H20FNO5
InChi Key: LWJGMYMNSNVCEM-UHFFFAOYSA-N
SMILES: COC1=CC=C2C=C(OCC3(CN(C3)C(=O)C3=CC=C(F)C=C3)C(O)=O)C=CC2=C1

 No hay refinamientos