man

Test

CAS RN 1150153-86-8

CH3NNO

CAS RN 1150153-86-8

IUPAC Name: 1-{9-methyl-9-azabicyclo[3.3.1]nonan-3-yl}-2,3-dihydro-1H-indol-2-one
Sinónimos: 1-{9-methyl-9-azabicyclo[3.3.1]nonan-3-yl}-3H-indol-2-one
Peso molecular (g/mol): 270.38
Fórmula molecular: C17H22N2O
InChi Key: GIDZCNCCCWFCIN-UHFFFAOYNA-N
SMILES: CN1C2CCCC1CC(C2)N1C(=O)CC2=CC=CC=C12

 No hay refinamientos