man

Test

CAS RN 1061747-72-5

CH3NNNNNHOH3CNNOH3CCH3

CAS RN 1061747-72-5

IUPAC Name: N-[2-(3,5-dimethyl-1H-pyrazol-1-yl)-6-[6-(4-methoxypiperidin-1-yl)pyridin-2-yl]pyrimidin-4-yl]acetamide
Sinónimos: N-[2-(3,5-dimethylpyrazol-1-yl)-6-[6-(4-methoxypiperidin-1-yl)pyridin-2-yl]pyrimidin-4-yl]acetamide
Peso molecular (g/mol): 421.51
Fórmula molecular: C22H27N7O2
InChi Key: JENSDTKXNVHSSN-UHFFFAOYSA-N
SMILES: COC1CCN(CC1)C1=CC=CC(=N1)C1=CC(NC(C)=O)=NC(=N1)N1N=C(C)C=C1C

 No hay refinamientos