missing translation for 'onlineSavingsMsg'
Learn More
Learn More
HEPES (Finos cristales blancos/Biología molecular), Fisher BioReagents
Agente tamponador de uso habitual
Marca: Fisher Bioreagents BP310-5
Detalles adicionales : CAS : 7365-45-9 Peso : 5.05000kg
Descripción
Agente tamponador de uso habitual
Suele utilizarse HEPES como tampón.Especificaciones
| 0.01 max. (0.1M solution) at 280nm | |
| 7365-45-9 | |
| 5.0 to 6.5 | |
| 5 kg | |
| DNase-, RNase- and Protease-Free | |
| Pass Test | |
| C8H18N2O4S | |
| Balde de polietileno | |
| 15, 4689 | |
| Soluble en agua | |
| OCCN1CCN(CCS(O)(=O)=O)CC1 | |
| 238.30 | |
| CHEBI:42334 | |
| Biología molecular |
| HEPES | |
| Blanco | |
| Crystals | |
| Sin ADNasa | |
| N-2-hidroxietilopiperacina-N-2-etano ácido sulfónico | |
| ≥99 % | |
| MFCD00006158 | |
| Protease free | |
| N-(2-Hydroxyethyl)piperazine-N«-2-ethanesulfonic Acid | |
| JKMHFZQWWAIEOD-UHFFFAOYSA-N | |
| ácido 2-[4-(2-hidroxietil)piperazin-1-il]etanosulfónico | |
| 23831 | |
| ≥99% |