Learn More
Bromophenol Blue, ACROS Organics™
Marca: Acros Organics 403140050
Detalles adicionales : CAS : 115-39-9 Peso : 0.05500kg
Cantidad. | 5g |
---|---|
Envase | Glass bottle |
Descripción
IndicatorIdentificadores de productos químicos
115-39-9 | |
669.96 | |
UDSAIICHUKSCKT-UHFFFAOYSA-N | |
8272 | |
2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
C19H10Br4O5S | |
MFCD00005875 | |
3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
CHEBI:59424 | |
C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Especificaciones
Bromophenol Blue | |
115-39-9 | |
C19H10Br4O5S | |
19, I, 649 | |
3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
Authentic | |
2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
8272 | |
669.96 | |
ACS Reagent | |
from pH 3.0 (yellow) to pH 4.6 (blue) | |
Orange-Pink to Red or Purple |
Pure | |
Passes Test | |
MFCD00005875 | |
15, 1454 | |
UDSAIICHUKSCKT-UHFFFAOYSA-N | |
C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
669.96 | |
CHEBI:59424 | |
Powder | |
Glass bottle | |
279.0°C | |
5g |