Learn More
Bromophenol Blue, ACROS Organics™
Marca: Acros Organics 403140050
Detalles adicionales : CAS : 115-39-9 Peso : 0.05500kg
| Cantidad. | 5g |
|---|---|
| Envase | Glass bottle |
Descripción
IndicatorIdentificadores de productos químicos
| 115-39-9 | |
| 669.96 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| 8272 | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol |
| C19H10Br4O5S | |
| MFCD00005875 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| CHEBI:59424 | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br |
Especificaciones
| Bromophenol Blue | |
| 115-39-9 | |
| C19H10Br4O5S | |
| 19, I, 649 | |
| 3',3'',5',5''-Tetrabromophenolsulfonephthalein, BPB, 3', 3'', 5' | |
| Authentic | |
| 2,6-dibromo-4-[3-(3,5-dibromo-4-hydroxyphenyl)-1,1-dioxo-2,1$l^{6}-benzoxathiol-3-yl]phenol | |
| 8272 | |
| 669.96 | |
| ACS Reagent | |
| from pH 3.0 (yellow) to pH 4.6 (blue) | |
| Orange-Pink to Red or Purple |
| Pure | |
| Passes Test | |
| MFCD00005875 | |
| 15, 1454 | |
| UDSAIICHUKSCKT-UHFFFAOYSA-N | |
| C1=CC=C2C(=C1)C(OS2(=O)=O)(C3=CC(=C(C(=C3)Br)O)Br)C4=CC(=C(C(=C4)Br)O)Br | |
| 669.96 | |
| CHEBI:59424 | |
| Powder | |
| Glass bottle | |
| 279.0°C | |
| 5g |