man

Test

CAS RN 1170613-55-4

CH3NOHFH3C

CAS RN 1170613-55-4

IUPAC Name: N-[1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine
Sinónimos: N-[1-(4-fluorophenyl)-2-methylpent-1-en-3-ylidene]hydroxylamine
Peso molecular (g/mol): 207.25
Fórmula molecular: C12H14FNO
InChi Key: HKROEBDHHKMNBZ-UHFFFAOYSA-N
SMILES: CCC(=NO)C(C)=CC1=CC=C(F)C=C1

 No hay refinamientos