missing translation for 'onlineSavingsMsg'
Learn More
Learn More
N-acetil-D-galactosamina, 98 %, Thermo Scientific Chemicals
213.00€ - 673.00€
Identificadores de productos químicos
| CAS | 1811-31-0 |
|---|---|
| Fórmula molecular | C8H15NO6 |
| Peso molecular (g/mol) | 221.21 |
| Número MDL | MFCD00136044 |
| Clave InChI | OVRNDRQMDRJTHS-KEWYIRBNSA-N |
| Sinónimo | dsstox_cid_28637, dsstox_rid_82907, dsstox_gsid_48711, n-acetyl-, a-d-galactosamine |
| PubChem CID | 60196345 |
| Nombre IUPAC | N-[(2R,3S,4S,5S)-3,4,5,6-tetrahidroxi-1-oxohexan-2-il]acetamida |
| SMILES | CC(=O)N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O |
| Código de producto | Marca | Cantidad | Envase | Precio | Cantidad y disponibilidad | ||||
|---|---|---|---|---|---|---|---|---|---|
| Código de producto | Marca | Cantidad | Envase | Precio | Cantidad y disponibilidad | ||||
|
11955481
|
Thermo Scientific Acros
434920010 |
1 g | Frasco de vidrio |
213.00€
1 g |
Por favor, inicie sesión para comprar este producto. ¿No tiene usuario web? Regístrese hoy mismo. | ||||
|
11965481
|
Thermo Scientific Acros
434920050 |
5 g | Frasco de vidrio |
673.00€
5 g |
Por favor, inicie sesión para comprar este producto. ¿No tiene usuario web? Regístrese hoy mismo. | ||||
Descripción
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identificadores de productos químicos
| 1811-31-0 | |
| 221.21 | |
| OVRNDRQMDRJTHS-KEWYIRBNSA-N | |
| 60196345 | |
| CC(=O)N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O |
| C8H15NO6 | |
| MFCD00136044 | |
| dsstox_cid_28637, dsstox_rid_82907, dsstox_gsid_48711, n-acetyl-, a-d-galactosamine | |
| N-[(2R,3S,4S,5S)-3,4,5,6-tetrahidroxi-1-oxohexan-2-il]acetamida |
Spezifikation
| N-Acetyl-D-galactosamine | |
| 97.5 | |
| 158.0°C to 166.0°C | |
| Auténtico | |
| C8H15NO6 | |
| 85.3 | |
| (10% in water) Clear colorless | |
| CC(=O)N[C@H]1C(O)O[C@H](CO)[C@H](O)[C@@H]1O | |
| 221.21 | |
| 221.21 | |
| Polvo cristalino |
| 1811-31-0 | |
| 100.0 | |
| Blanco | |
| 97.5% min. (HPLC) | |
| MFCD00136044 | |
| dsstox_cid_28637, dsstox_rid_82907, dsstox_gsid_48711, n-acetyl-, a-d-galactosamine | |
| OVRNDRQMDRJTHS-KEWYIRBNSA-N | |
| N-[(2R,3S,4S,5S)-3,4,5,6-tetrahidroxi-1-oxohexan-2-il]acetamida | |
| 60196345 | |
| 98% |
Sicherheit und Handhabung
missing translation for 'einecsNumber' : 217-321-9
RUO – Research Use Only